Guanosine 5-triphosphate disodium salt
$200.00
CAS No.: 56001-37-7
Catalog No.: 193438
Purity: 95%
MF: C10H16N5Na2O14P3
MW: 569.161
Storage: 2-8 degree Celsius
SMILES: [Na].[Na].O(P(O)(=O)OP(=O)(O)OP(=O)(O)O)C[C@H]1O[C@H]([C@@H]([C@@H]1O)O)N1C=2NC(=NC(C2N=C1)=O)N
Catalog No.: 193438
Purity: 95%
MF: C10H16N5Na2O14P3
MW: 569.161
Storage: 2-8 degree Celsius
SMILES: [Na].[Na].O(P(O)(=O)OP(=O)(O)OP(=O)(O)O)C[C@H]1O[C@H]([C@@H]([C@@H]1O)O)N1C=2NC(=NC(C2N=C1)=O)N
For R&D use only. Not for human or animal use.
Guanosine-5'-triphosphoric aicd disodium salt; CAS No.: 56001-37-7 - This compound is a critical component in the synthesis of complex organic molecules, particularly in pharmaceutical research. Its unique properties facilitate the development of new drugs. ChemShuttle's extensive inventory and streamlined purchasing process ensure that researchers can easily obtain the compounds they need.
Reviews
Write Your Own Review