Fipronil
$300.00
CAS No.: 120068-37-3
Catalog No.: 155677
Purity: 95%
MF: C12H4Cl2F6N4OS
MW: 437.152
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=NN1C1=C(Cl)C=C(C=C1Cl)C(F)(F)F)C#N)S(=O)C(F)(F)F
Catalog No.: 155677
Purity: 95%
MF: C12H4Cl2F6N4OS
MW: 437.152
Storage: 2-8 degree Celsius
SMILES: NC1=C(C(=NN1C1=C(Cl)C=C(C=C1Cl)C(F)(F)F)C#N)S(=O)C(F)(F)F
5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-trifluoromethanesulfinyl-1H-pyrazole-3-carbonitrile; CAS No.: 120068-37-3 - A novel compound with potential applications in the development of new drugs, particularly in targeting specific pathways or mechanisms. ChemShuttle's focus on innovative bioactive compounds ensures access to cutting-edge research materials.
Reviews
Write Your Own Review