FAPI-02 TFA
$150.00
CAS No.: 1448440-40-1
Catalog No.: 129319
Purity: 95%
MF: C9H10F5N3O3
MW: 303.187
Storage: 2-8 degree Celsius
SMILES: OC(=O)C(F)(F)F.NCC(=O)N1CC(F)(F)C[C@H]1C#N
Catalog No.: 129319
Purity: 95%
MF: C9H10F5N3O3
MW: 303.187
Storage: 2-8 degree Celsius
SMILES: OC(=O)C(F)(F)F.NCC(=O)N1CC(F)(F)C[C@H]1C#N
CAS NO.: 1448440-40-1; (S)-1-(2-Aminoacetyl)-4,4-difluoropyrrolidine-2-carbonitrile 2,2,2-trifluoroacetate (FAPI-02 TFA). PROPERTIES: FAPI-02 TFA is a solid compound with multiple functional groups, including amino, carbonitrile, and trifluoroacetate moieties. It has specific solubility characteristics, being soluble in some organic solvents suitable for biochemical experiments. It should be stored at low temperatures, preferably in a freezer, in a sealed container to maintain its stability. From a safety perspective, it may be toxic if ingested or absorbed through the skin, so strict safety protocols, including proper handling and disposal, should be followed. APPLICATIONS: FAPI-02 TFA is used in the field of radiopharmaceuticals and molecular imaging. It can serve as a precursor for the synthesis of imaging agents that target specific proteins or receptors in the body. By conjugating it with appropriate radionuclides, it enables the visualization of biological processes and the detection of diseases, such as cancer, through techniques like positron emission tomography (PET). Its application in molecular imaging is based on the principles of radiopharmaceutical chemistry and the development of targeted imaging agents, as reported in nuclear medicine and radiochemistry research.
Reviews
Write Your Own Review