ethyl 4-(trifluoromethyl)benzoate
$200.00
CAS No.: 583-02-8
Catalog No.: 192437
Purity: 95%
MF: C10H9F3O2
MW: 218.174
Storage: 2-8 degree Celsius
SMILES: FC(C1=CC=C(C(=O)OCC)C=C1)(F)F
Catalog No.: 192437
Purity: 95%
MF: C10H9F3O2
MW: 218.174
Storage: 2-8 degree Celsius
SMILES: FC(C1=CC=C(C(=O)OCC)C=C1)(F)F
ethyl 4-(trifluoromethyl)benzoate; CAS No.: 583-02-8; ethyl 4-(trifluoromethyl)benzoate. PROPERTIES: ethyl 4-(trifluoromethyl)benzoate is a colorless liquid with molecular formula C10H9F3O2. It has a boiling point around 220-225 C and exhibits good solubility in common organic solvents. The compound should be stored in a tightly sealed container at room temperature away from heat sources. Safety precautions include avoiding inhalation of vapors and using appropriate respiratory protection due to its potential to cause respiratory irritation. APPLICATIONS: This trifluoromethyl-substituted benzoate is employed in the development of liquid crystal materials. The ester group enhances mesomorphic properties as described in materials chemistry research. In pharmaceutical synthesis, ethyl 4-(trifluoromethyl)benzoate serves as a building block for creating fluorinated pharmaceuticals. According to medicinal chemistry journals, the benzoate group provides sites for further functionalization while the trifluoromethyl atoms offer metabolic stability.
Reviews
Write Your Own Review