ethyl 4-bromo-3-fluorophenylacetate
$350.00
CAS No.: 1296223-82-9
Catalog No.: WLZ1794
Purity: 95%
MF: C10H10BrFO2
MW: 261.09
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)CC(=O)OCC)F
Catalog No.: WLZ1794
Purity: 95%
MF: C10H10BrFO2
MW: 261.09
Storage: 2-8 degree Celsius
SMILES: BrC1=C(C=C(C=C1)CC(=O)OCC)F
CAS NO.: 1296223-82-9; ethyl 4-bromo-3-fluorophenylacetate. PROPERTIES: This bromofluorinated aromatic ester features a bromine atom and a fluorine atom on a phenyl ring connected to an ethyl acetate group, creating a molecule with potential applications in organic synthesis and pharmaceutical research. The ethyl 4-bromo-3-fluorophenylacetate typically appears as a colorless to pale yellow liquid with moderate solubility in common organic solvents. Its molecular structure includes multiple halogen atoms that influence the electronic properties of the aromatic system. For optimal stability and to prevent premature reactions, this compound should be stored at 2-8 degree Celsius in an amber glass bottle under an inert atmosphere. When handling, appropriate safety measures including nitrile gloves and safety goggles are recommended. This compound is sensitive to light and moisture, requiring careful environmental control during storage and use. In case of skin contact, wash thoroughly with soap and water; if eye contact occurs, rinse immediately and seek medical evaluation. APPLICATIONS: The ethyl 4-bromo-3-fluorophenylacetate serves as a versatile building block in organic synthesis, particularly for creating halogenated bioactive molecules. The ester group provides a handle for further functionalization through hydrolysis to the corresponding carboxylic acid or transesterification. In medicinal chemistry, this compound functions as an intermediate for developing pharmaceuticals targeting enzyme inhibitors and receptor modulators. The bromine and fluorine substituents contribute to target binding affinity and selectivity. Additionally, the molecule finds utility in materials science as a monomer for creating polymers with specific electronic and optical properties. Researchers utilizing this compound can benefit from its functional group versatility, enabling the development of diverse molecular architectures for applications ranging from drug discovery to advanced materials.
Reviews
Write Your Own Review