ethyl 3-(4-bromophenyl)-3-oxopropanoate
$250.00
CAS No.: 26510-95-2
Catalog No.: 196546
Purity: 95%
MF: C11H11BrO3
MW: 271.11
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)C(CC(=O)OCC)=O
Catalog No.: 196546
Purity: 95%
MF: C11H11BrO3
MW: 271.11
Storage: 2-8 degree Celsius
SMILES: BrC1=CC=C(C=C1)C(CC(=O)OCC)=O
ethyl 3-(4-bromophenyl)-3-oxopropanoate; CAS No.: 26510-95-2; ethyl 3-(4-bromophenyl)-3-oxopropanoate. PROPERTIES: Ethyl 3-(4-bromophenyl)-3-oxopropanoate is a colorless to pale yellow liquid with molecular formula C12H12BrO3. It exhibits a boiling point of approximately 290 C at 760 mmHg and has limited water solubility. This compound should be stored at temperatures below 20 C in a tightly sealed container, preferably under inert atmosphere to prevent oxidation. Safety precautions include using chemical-resistant gloves and eye protection. If spilled, the area should be ventilated and cleaned with absorbent material. In case of skin contact, wash thoroughly with soap and water. APPLICATIONS: This compound is widely used as a key intermediate in the synthesis of nonsteroidal anti-inflammatory drugs (NSAIDs). Its ϫ-keto ester structure undergoes selective transformation to form active pharmaceutical ingredients (pharmaceutical manufacturing). In materials science, ethyl 3-(4-bromophenyl)-3-oxopropanoate serves as a monomer for specialty polymers with tailored thermal properties (polymer chemistry research). The bromophenyl group enables further functionalization through cross-coupling reactions, making it valuable in the development of optoelectronic materials (materials science applications).
Reviews
Write Your Own Review