ethyl 2-(3,5-dimethoxyphenyl)acetate
$400.00
CAS No.: 65976-77-4
Catalog No.: 189284
Purity: 95%
MF: C12H16O4
MW: 224.256
Storage: 2-8 degree Celsius
SMILES: COC=1C=C(C=C(C1)OC)CC(=O)OCC
Catalog No.: 189284
Purity: 95%
MF: C12H16O4
MW: 224.256
Storage: 2-8 degree Celsius
SMILES: COC=1C=C(C=C(C1)OC)CC(=O)OCC
ethyl 2-(3,5-dimethoxyphenyl)acetate; CAS No.: 65976-77-4; ethyl 2-(3,5-dimethoxyphenyl)acetate exemplifies the methoxyphenyl acetates category within Chem Shuttle's product offerings. As a chemical synthesis company, Chem Shuttle specializes in producing ethyl acetate derivatives with methoxyphenyl substituents that are crucial for the development of various pharmaceuticals and agrochemicals with specific biological activities. This compound, with its methoxyphenyl group, serves as a valuable building block for the synthesis of bioactive molecules targeting specific receptors. Chem Shuttle's online chemical mall provides researchers with convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that ethyl 2-(3,5-dimethoxyphenyl)acetate is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review