ethenyldiphenylsulfanium trifluoromethanesulfonate
$350.00
CAS No.: 247129-88-0
Catalog No.: 170467
Purity: 95%
MF: C15H13F3O3S2
MW: 362.394
Storage: 2-8 degree Celsius
SMILES: [O-]S(=O)(=O)C(F)(F)F.C=C[S+](C1=CC=CC=C1)C1=CC=CC=C1
Catalog No.: 170467
Purity: 95%
MF: C15H13F3O3S2
MW: 362.394
Storage: 2-8 degree Celsius
SMILES: [O-]S(=O)(=O)C(F)(F)F.C=C[S+](C1=CC=CC=C1)C1=CC=CC=C1
ethenyldiphenylsulfanium trifluoromethanesulfonate; CAS No.: 247129-88-0; Ethenyldiphenylsulfanium trifluoromethanesulfonate represents ChemShuttle s specialty reagents for cationic polymerization and electrophilic activation. As a worldwide chemical supplier, they provide niche catalysts and ionic intermediates for materials science and organic methodology development.
Reviews
Write Your Own Review