cis-3,4-piperidinediol hydrochloride
$195.00
CAS No.: 443648-89-3
Catalog No.: 170289
Purity: 95%
MF: C5H12ClNO2
MW: 153.609
Storage: 2-8 degree Celsius
SMILES: Cl[H].O[C@@H]1CCNC[C@@H]1O
Catalog No.: 170289
Purity: 95%
MF: C5H12ClNO2
MW: 153.609
Storage: 2-8 degree Celsius
SMILES: Cl[H].O[C@@H]1CCNC[C@@H]1O
cis-3,4-piperidinediol hydrochloride; CAS No.: 443648-89-3; cis-3,4-piperidinediol hydrochloride represents ChemShuttle's building blocks for drug discovery. As a worldwide chemical supplier, we provide chiral piperidine derivatives with diol functionality for research applications. This compound features cis-dihydroxy substitution on a piperidine ring, providing unique steric properties. ChemShuttle's custom synthesis services enable researchers to access tailored chiral compounds with specific configurations. The hydrochloride salt form ensures stability and solubility, making this compound valuable in medicinal chemistry projects.
Reviews
Write Your Own Review