methyl 4-amino-3-ethylbenzoate

methyl 4-amino-3-ethylbenzoate

methyl 4,5-difluoro-2-methylbenzoate

methyl 4,5-difluoro-2-methylbenzoate

methyl 4-amino-2-cyanobenzoate

$350.00
CAS No.: 1628431-65-1
Catalog No.: 194142
Purity: 95%
MF: C9H8N2O2
MW: 176.175
Storage: 2-8 degree Celsius
SMILES: NC1=CC(=C(C(=O)OC)C=C1)C#N
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194142
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-amino-2-cyanobenzoate; CAS No.: 1628431-65-1; methyl 4-amino-2-cyanobenzoate. PROPERTIES: methyl 4-amino-2-cyanobenzoate is a crystalline solid. Its molecular formula is C10H8N2O2, and the molecular weight is approximately 188.19 g/mol. The compound has a melting point of approximately 160-162 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amino group and a cyano group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 4-amino-2-cyanobenzoate serves as a valuable intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The cyano group can be converted to other functional groups such as carboxylic acid or amine. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 4-amino-2-cyanobenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-amino-2-cyanobenzoate
Your Rating