•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Triazines

Set Ascending Direction

   

Items 11 to 20 of 41 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 1,3-dibromo-1,3,5-triazinane-2,4,6-trione

    CAS No.: 15114-43-9
    Catalog No.: 104472
    Purity: 95%
    MF: C3HBr2N3O3
    MW: 286.867
    Storage: 2-8 degree Celsius
    SMILES: BrN1C(=O)NC(=O)N(Br)C1=O
  2. ethyl 3-bromo-1,2,4-triazine-6-carboxylate

    CAS No.: 2091717-09-6
    Catalog No.: 197633
    Purity: 95%
    MF: C6H6BrN3O2
    MW: 232.037
    Storage: 2-8 degree Celsius
    SMILES: BrC=1N=NC(=CN1)C(=O)OCC
  3. 4-chloro-N,6-diphenyl-1,3,5-triazin-2-amine

    CAS No.: 3842-52-2
    Catalog No.: 129585
    Purity: 95%
    MF: C15H11ClN4
    MW: 282.734
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(NC2=CC=CC=C2)=NC(=N1)C1=CC=CC=C1
  4. tert-butyl (Z)-(((tert-butoxycarbonyl)imino)(3,5-dimethyl-4-oxo-1,3,5-triazinan-1-yl)methyl)carbamate

    CAS No.: 911857-61-9
    Catalog No.: 133940
    Purity: 95%
    MF: C16H29N5O5
    MW: 371.438
    Storage: 2-8 degree Celsius
    SMILES: CN1CN(CN(C)C1=O)C(\NC(=O)OC(C)(C)C)=N/C(=O)OC(C)(C)C
  5. 1,3-dimethyl-1,3,5-triazinan-2-one

    CAS No.: 96591-16-1
    Catalog No.: 133941
    Purity: 95%
    MF: C5H11N3O
    MW: 129.163
    Storage: 2-8 degree Celsius
    SMILES: CN1CNCN(C)C1=O
  6. tert-butyl (((tert-butoxycarbonyl)imino)(1H-pyrazol-1-yl)methyl)carbamate

    CAS No.: 152120-54-2
    Catalog No.: 133942
    Purity: 95%
    MF: C14H22N4O4
    MW: 310.354
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)NC(=NC(=O)OC(C)(C)C)N1C=CC=N1
  7. 1,3,5-trihydroxy-1,3,5-triazinane-2,4,6-trione

    CAS No.: 143435-52-3
    Catalog No.: LT0053
    Purity: 95%
    MF: C3H3N3O6
    MW: 177.072
    Storage: 2-8 degree Celsius
    SMILES: ON1C(N(C(N(C1=O)O)=O)O)=O
  8. 4-chloro-6-methyl-1,3,5-triazin-2-amine

    CAS No.: 21320-62-7
    Catalog No.: WLZ2705
    Purity: 95%
    MF: C4H5ClN4
    MW: 144.565
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=NC(=N1)C)N
  9. 2-(3-bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine

    CAS No.: 1073062-42-6
    Catalog No.: ZB0175
    Purity: 95%
    MF: C21H13BrClN3
    MW: 422.713
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C=C(C1)Cl)C1=NC(=NC(=N1)C1=CC=CC=C1)C1=CC=CC=C1
  10. 6-vinyl-1,3,5-triazine-2,4-diamine

    CAS No.: 3194-70-5
    Catalog No.: ZB2221
    Purity: 95%
    MF: C5H7N5
    MW: 137.146
    Storage: 2-8 degree Celsius
    SMILES: C(=C)C1=NC(=NC(=N1)N)N
Loading ...Load More ...
Set Ascending Direction

   

Items 11 to 20 of 41 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5