•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Transmembrane Transporters

Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3
  1. VX-661

    CAS No.: 1152311-62-0
    Catalog No.: 109852
    Purity: 95%
    MF: C26H27F3N2O6
    MW: 520.504
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(CO)C1=CC2=C(C=C(F)C(NC(=O)C3(CC3)C3=CC=C4OC(F)(F)OC4=C3)=C2)N1C[C@@H](O)CO
  2. (S)-(-)-Blebbistatin

    CAS No.: 856925-71-8
    Catalog No.: 109846
    Purity: 95%
    MF: C18H16N2O2
    MW: 292.338
    Storage: 2-8 degree Celsius
    SMILES: CC1=CC2=C(C=C1)N=C1N(CC[C@@]1(O)C2=O)C1=CC=CC=C1
  3. Vonoprazan Fumarate; TAK-438

    CAS No.: 881681-01-2
    Catalog No.: 104784
    Purity: 95%
    MF: C21H20FN3O6S
    MW: 461.471
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)\C=C\C(O)=O.CNCC1=CN(C(=C1)C1=CC=CC=C1F)S(=O)(=O)C1=CC=CN=C1
  4. NS8593 hydrochloride

    CAS No.: 875755-24-1
    Catalog No.: 193725
    Purity: 95%
    MF: C17H18ClN3
    MW: 299.805
    Storage: 2-8 degree Celsius
    SMILES: Cl.[C@H]1(CCCC2=CC=CC=C12)NC1=NC2=C(N1)C=CC=C2
  5. Elexacaftor (VX-445)

    CAS No.: 2216712-66-0
    Catalog No.: 193671
    Purity: 95%
    MF: C26H34F3N7O4S
    MW: 597.664
    Storage: 2-8 degree Celsius
    SMILES: CN1N=C(C(=C1)S(=O)(=O)NC(C1=C(N=C(C=C1)N1N=C(C=C1)OCC(C(F)(F)F)(C)C)N1C(C[C@@H](C1)C)(C)C)=O)C
  6. LY-3475070(CD73-IN-3)

    CAS No.: 2375815-63-5
    Catalog No.: 193667
    Purity: 95%
    MF: C15H18N4O2
    MW: 286.335
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)[C@@H]1[C@H](C1)C=1C=C(N=NC1C)C=1C(NC(NC1)=O)=O
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 26 of 26 total

  1. 1
  2. 2
  3. 3