•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiophenes

Set Ascending Direction

   

Items 41 to 50 of 399 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7
  1. 1-isopropyl-6-(thiophen-2-yl)-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

    CAS No.: 879576-89-3
    Catalog No.: TQR950
    Purity: 95%
    MF: C14H13N3O2S
    MW: 287.344
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)N1N=CC2=C1N=C(C=C2C(=O)O)C=2SC=CC2
  2. 2-mercapto-6-oxo-4-(thiophen-2-yl)-1,6-dihydropyrimidine-5-carbonitrile

    CAS No.: 109532-65-2
    Catalog No.: TQR969
    Purity: 95%
    MF: C9H5N3OS2
    MW: 235.293
    Storage: 2-8 degree Celsius
    SMILES: SC=1NC(C(=C(N1)C=1SC=CC1)C#N)=O
  3. 5,5'-dibromo-2,2'-bithiophene

    CAS No.: 4805-22-5
    Catalog No.: 102078
    Purity: 95%
    MF: C8H4Br2S2
    MW: 324.062
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(S1)C1=CC=C(Br)S1
  4. 4-bromothiophene-3-carboxylic acid

    CAS No.: 16694-17-0
    Catalog No.: 102460
    Purity: 95%
    MF: C5H3BrO2S
    MW: 207.048
    Storage: 2-8 degree Celsius
    SMILES: OC(=O)C1=CSC=C1Br
  5. (3-methylthiophen-2-yl)boronic acid

    CAS No.: 177735-09-0
    Catalog No.: 107607
    Purity: 95%
    MF: C5H7BO2S
    MW: 141.988
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(SC=C1)B(O)O
  6. (E)-2-(2-nitrovinyl)thiophene

    CAS No.: 34312-77-1
    Catalog No.: 107611
    Purity: 95%
    MF: C6H5NO2S
    MW: 155.178
    Storage: 2-8 degree Celsius
    SMILES: [O-][N+](=O)\C=C\C1=CC=CS1
  7. (E)-4-(thiophen-2-yl)but-3-en-2-one

    CAS No.: 33603-63-3
    Catalog No.: 107612
    Purity: 95%
    MF: C8H8OS
    MW: 152.218
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)\C=C\C1=CC=CS1
  8. N-hydroxythiophene-2-carboximidamide

    CAS No.: 53370-51-7
    Catalog No.: 107613
    Purity: 95%
    MF: C5H6N2OS
    MW: 142.183
    Storage: 2-8 degree Celsius
    SMILES: N=C(NO)C1=CC=CS1
  9. 1-(5-chlorothiophen-2-yl)ethanone

    CAS No.: 6310-09-4
    Catalog No.: 107614
    Purity: 95%
    MF: C6H5ClOS
    MW: 160.625
    Storage: 2-8 degree Celsius
    SMILES: CC(=O)C1=CC=C(Cl)S1
  10. 1,3-dimethyl-2-(thiophen-2-yl)imidazolidine

    CAS No.: 104208-13-1
    Catalog No.: 107615
    Purity: 95%
    MF: C9H14N2S
    MW: 182.292
    Storage: 2-8 degree Celsius
    SMILES: CN1CCN(C)C1C1=CC=CS1
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 399 total

  1. 3
  2. 4
  3. 5
  4. 6
  5. 7