•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Thiazolopyridines

Set Ascending Direction

   

Items 1 to 10 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 7-bromo-2-methyl-6-nitrothiazolo[5,4-b]pyridine

    CAS No.: 2178984-61-5
    Catalog No.: 187801
    Purity: 95%
    MF: C7H4BrN3O2S
    MW: 274.099
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(=NC=C1[N+](=O)[O-])SC(=N2)C
  2. 6-nitro-2-(trifluoromethyl)thiazolo[5,4-b]pyridin-7-amine

    CAS No.: 2178985-04-9
    Catalog No.: TQP1704
    Purity: 95%
    MF: C7H3F3N4O2S
    MW: 264.188
    Storage: 2-8 degree Celsius
    SMILES: [N+](=O)([O-])C=1C(=C2C(=NC1)SC(=N2)C(F)(F)F)N
  3. 7-bromo-6-nitro-2-(trifluoromethyl)thiazolo[5,4-b]pyridine

    CAS No.: 2178985-07-2
    Catalog No.: TQP1705
    Purity: 95%
    MF: C7HBrF3N3O2S
    MW: 328.069
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C2C(=NC=C1[N+](=O)[O-])SC(=N2)C(F)(F)F
  4. 1-(6-amino-2-methylthiazolo[5,4-b]pyridin-7-yl)ethanone

    CAS No.: 2178985-13-0
    Catalog No.: TQP1706
    Purity: 95%
    MF: C9H9N3OS
    MW: 207.258
    Storage: 2-8 degree Celsius
    SMILES: NC=1C(=C2C(=NC1)SC(=N2)C)C(C)=O
  5. thiazolo[5,4-c]pyridine-2-thiol

    CAS No.: 116990-44-4
    Catalog No.: 103101
    Purity: 95%
    MF: C6H4N2S2
    MW: 168.246
    Storage: 2-8 degree Celsius
    SMILES: SC1=NC2=C(S1)C=NC=C2
  6. thiazolo[4,5-c]pyridin-2-amine

    CAS No.: 89786-54-9
    Catalog No.: 135067
    Purity: 95%
    MF: C6H5N3S
    MW: 151.194
    Storage: 2-8 degree Celsius
    SMILES: NC1=NC2=CN=CC=C2S1
  7. tert-butyl 2-amino-3a,4,7,7a-tetrahydrothiazolo[5,4-c]pyridine-5(6H)-carboxylate

    CAS No.: 1822507-16-3
    Catalog No.: 151242
    Purity: 95%
    MF: C11H19N3O2S
    MW: 257.359
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCC2N=C(N)SC2C1
  8. ethyl 5-chlorothiazolo[5,4-b]pyridine-2-carboxylate

    CAS No.: 1202075-71-5
    Catalog No.: 186085
    Purity: 95%
    MF: C9H7ClN2O2S
    MW: 242.687
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C2C(=N1)SC(=N2)C(=O)OCC
  9. 2-methyl-6-nitrothiazolo[5,4-b]pyridin-7-amine

    CAS No.: 2178984-57-9
    Catalog No.: 187800
    Purity: 95%
    MF: C7H6N4O2S
    MW: 210.218
    Storage: 2-8 degree Celsius
    SMILES: CC=1SC2=NC=C(C(=C2N1)N)[N+](=O)[O-]
  10. 6-bromothiazolo[5,4-b]pyridin-2-amine

    CAS No.: 1160791-13-8
    Catalog No.: 196088
    Purity: 95%
    MF: C6H4BrN3S
    MW: 230.09
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C2C(=NC1)SC(=N2)N
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 35 total

  1. 1
  2. 2
  3. 3
  4. 4