•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Tetrahydrofurans

Set Descending Direction

   

Items 21 to 30 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (3S,4S)-4-(4-bromo-3-fluorophenoxy)tetrahydrofuran-3-amine

    CAS No.: NA
    Catalog No.: 193391
    Purity: 95%
    MF: C10H11BrFNO2
    MW: 276.105
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=C(O[C@H]2[C@H](COC2)N)C=C1)F
  2. tetrahydrofuran-2-carboximidamide hydrochloride

    CAS No.: 619329-27-0
    Catalog No.: WLZ2552
    Purity: 95%
    MF: C5H11ClN2O
    MW: 150.609
    Storage: 2-8 degree Celsius
    SMILES: Cl.O1C(CCC1)C(N)=N
  3. (R)-tetrahydrofuran-3-yl4-methylbenzenesulfonate

    CAS No.: 219823-47-9
    Catalog No.: WLZ2795
    Purity: 95%
    MF: C11H14O4S
    MW: 242.296
    Storage: 2-8 degree Celsius
    SMILES: O1C[C@@H](CC1)OS(=O)(=O)C1=CC=C(C=C1)C
  4. (3S,5R)-5-(hydroxymethyl)tetrahydrofuran-3-ol

    CAS No.: 204509-32-0
    Catalog No.: WLZ2839
    Purity: 95%
    MF: C5H10O3
    MW: 118.132
    Storage: 2-8 degree Celsius
    SMILES: OC[C@H]1C[C@@H](CO1)O
  5. methyl 5-oxotetrahydrofuran-2-carboxylate

    CAS No.: 3885-29-8
    Catalog No.: WLZ3089
    Purity: 95%
    MF: C6H8O4
    MW: 144.126
    Storage: 2-8 degree Celsius
    SMILES: O=C1CCC(O1)C(=O)OC
  6. 2-amino-2-(tetrahydrofuran-3-yl)acetic acid

    CAS No.: 1169930-49-7
    Catalog No.: 192574
    Purity: 95%
    MF: C6H11NO3
    MW: 145.158
    Storage: 2-8 degree Celsius
    SMILES: NC(C(=O)O)C1COCC1
  7. (3R)-oxolan-3-ylmethanamine hydrochloride

    CAS No.: 1400744-17-3
    Catalog No.: 170957
    Purity: 95%
    MF: C5H12ClNO
    MW: 137.61
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC[C@H]1CCOC1
  8. 3-oxo-3-(tetrahydrofuran-3-yl)propanenitrile

    CAS No.: 1186610-03-6
    Catalog No.: 192575
    Purity: 95%
    MF: C7H9NO2
    MW: 139.154
    Storage: 2-8 degree Celsius
    SMILES: O=C(CC#N)C1COCC1
  9. (R)-tert-butyl 5-oxo-tetrahydrofuran-3-ylcarbamate

    CAS No.: 137105-97-6
    Catalog No.: 192576
    Purity: 95%
    MF: C9H15NO4
    MW: 201.222
    Storage: 2-8 degree Celsius
    SMILES: O=C1C[C@H](CO1)NC(OC(C)(C)C)=O
  10. (trans)-tetrahydrofuran-3,4-dicarboxylic acid

    CAS No.: 1903836-65-6
    Catalog No.: 192578
    Purity: 95%
    MF: C6H8O5
    MW: 160.125
    Storage: 2-8 degree Celsius
    SMILES: O1C[C@H]([C@@H](C1)C(=O)O)C(=O)O
Loading ...Load More ...
Set Descending Direction

   

Items 21 to 30 of 50 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5