•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridopyrimidines

Set Descending Direction

   

Items 31 to 40 of 127 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. methyl 4-chloropyrido[2,3-d]pyrimidine-2-carboxylate

    CAS No.: 1260761-86-1
    Catalog No.: 199180
    Purity: 95%
    MF: C9H6ClN3O2
    MW: 223.619
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C2=C(N=C(N1)C(=O)OC)N=CC=C2
  2. 2-chloropyrido[3,4-d]pyrimidine

    CAS No.: 1234616-61-5
    Catalog No.: 199427
    Purity: 95%
    MF: C7H4ClN3
    MW: 165.583
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=CC2=C(N1)C=NC=C2
  3. tert-butyl 2-(methylthio)-5,8-dihydropyrido[3,4-d]pyrimidine-7(6H)-carboxylate

    CAS No.: 1226776-86-8
    Catalog No.: WLZ3428
    Purity: 95%
    MF: C13H19N3O2S
    MW: 281.381
    Storage: 2-8 degree Celsius
    SMILES: CSC=1N=CC2=C(N1)CN(CC2)C(=O)OC(C)(C)C
  4. 2-methyl-4H-pyrido[1,2-a]pyrimidin-4-one

    CAS No.: 1693-94-3
    Catalog No.: WLZ3764
    Purity: 95%
    MF: C9H8N2O
    MW: 160.176
    Storage: 2-8 degree Celsius
    SMILES: CC=1N=C2N(C(C1)=O)C=CC=C2
  5. 2,4-dichloro-7-(trifluoromethyl)pyrido[2,3-d]pyrimidine

    CAS No.: 1220518-13-7
    Catalog No.: 100374
    Purity: 95%
    MF: C8H2Cl2F3N3
    MW: 268.025
    Storage: 2-8 degree Celsius
    SMILES: FC(F)(F)C1=NC2=NC(Cl)=NC(Cl)=C2C=C1
  6. 8-chloro-2-(methylsulfanyl)pyrido[3,4-d]pyrimidine

    CAS No.: 1578245-95-0
    Catalog No.: 195689
    Purity: 95%
    MF: C8H6ClN3S
    MW: 211.677
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC=CC2=C1N=C(N=C2)SC
  7. 5,7-dichloropyrido[4,3-d]pyrimidin-4(3H)-one

    CAS No.: 918898-11-0
    Catalog No.: 195690
    Purity: 95%
    MF: C7H3Cl2N3O
    MW: 216.027
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC(=CC=2N=CNC(C21)=O)Cl
  8. 2,4-dichloro-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidine

    CAS No.: 726697-13-8
    Catalog No.: 196400
    Purity: 95%
    MF: C7H7Cl2N3
    MW: 204.06
    Storage: 2-8 degree Celsius
    SMILES: ClC=1N=C(C2=C(N1)CCNC2)Cl
  9. 6-chloropyrido[3,4-d]pyrimidine

    CAS No.: 202273-25-4
    Catalog No.: 198199
    Purity: 95%
    MF: C7H4ClN3
    MW: 165.583
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(N=CN=C2)C=N1
  10. methyl 4-oxo-4H-pyrido[1,2-a]pyrimidine-2-carboxylate

    CAS No.: 23951-66-8
    Catalog No.: 198201
    Purity: 95%
    MF: C10H8N2O3
    MW: 204.185
    Storage: 2-8 degree Celsius
    SMILES: O=C1C=C(N=C2N1C=CC=C2)C(=O)OC
Loading ...Load More ...
Set Descending Direction

   

Items 31 to 40 of 127 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6