•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridines

Set Ascending Direction

   

Items 61 to 70 of 4138 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. (5-isopropylpyridin-2-yl)methanamine

    CAS No.: 1188477-20-4
    Catalog No.: GS2479
    Purity: 95%
    MF: C9H14N2
    MW: 150.225
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1C=CC(=NC1)CN
  2. tert-butyl 3-(6-fluoropyridin-3-yl)azetidine-1-carboxylate

    CAS No.: 1801986-14-0
    Catalog No.: GS3800
    Purity: 95%
    MF: C13H17FN2O2
    MW: 252.289
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=N1)C1CN(C1)C(=O)OC(C)(C)C
  3. tert-butyl 3-(3-bromopyridin-2-yl)azetidine-1-carboxylate

    CAS No.: 1349873-31-9
    Catalog No.: GS3810
    Purity: 95%
    MF: C13H17BrN2O2
    MW: 313.195
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NC=CC1)C1CN(C1)C(=O)OC(C)(C)C
  4. 2-(hydrazinylmethyl)pyridine trihydrochloride

    CAS No.: 1349718-42-8
    Catalog No.: LT0022
    Purity: 95%
    MF: C6H12Cl3N3
    MW: 232.542
    Storage: 2-8 degree Celsius
    SMILES: Cl.Cl.Cl.N(N)CC1=NC=CC=C1
  5. 4-bromo-3-methoxypyridine

    CAS No.: 109911-38-8
    Catalog No.: LT0134
    Purity: 95%
    MF: C6H6BrNO
    MW: 188.024
    Storage: 2-8 degree Celsius
    SMILES: BrC1=C(C=NC=C1)OC
  6. (1S,5R)-1-(2-chloro-4-fluorophenyl)-3-(5-(methoxymethyl)-4-(6-methoxypyridin-3-yl)-4H-1,2,4-triazol-3-yl)-3-azabicyclo[3.1.0]hexane

    CAS No.: 2231770-73-1
    Catalog No.: TQ0008
    Purity: 95%
    MF: C21H21ClFN5O2
    MW: 429.883
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC(=C1)F)[C@]12CN(C[C@@H]2C1)C1=NN=C(N1C=1C=NC(=CC1)OC)COC
  7. 3-methoxy-2-(piperidin-4-yl)pyridine

    CAS No.: 1256809-22-9
    Catalog No.: TQ0013
    Purity: 95%
    MF: C11H16N2O
    MW: 192.262
    Storage: 2-8 degree Celsius
    SMILES: COC=1C(=NC=CC1)C1CCNCC1
  8. 5-(1H-pyrazolo[4,3-c]pyridin-6-yl)spiro[2.3]hexane-5-carbonitrile

    CAS No.: NA
    Catalog No.: TQ0018
    Purity: 95%
    MF: C13H12N4
    MW: 224.267
    Storage: 2-8 degree Celsius
    SMILES: N1N=CC=2C=NC(=CC21)C2(CC1(CC1)C2)C#N
  9. methyl 4-amino-5-bromonicotinate

    CAS No.: 1446182-20-2
    Catalog No.: TQ0023
    Purity: 95%
    MF: C7H7BrN2O2
    MW: 231.049
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=NC=C1C(=O)OC)Br
  10. methyl 4,5-diaminonicotinate

    CAS No.: 1547007-21-5
    Catalog No.: TQ0024
    Purity: 95%
    MF: C7H9N3O2
    MW: 167.168
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=NC=C1C(=O)OC)N
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 4138 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9