•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyridines

Set Ascending Direction

   

Items 51 to 60 of 4138 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8
  1. 2-hydrazinyl-3-nitropyridine

    CAS No.: 15367-16-5
    Catalog No.: GS0004
    Purity: 95%
    MF: C5H6N4O2
    MW: 154.129
    Storage: 2-8 degree Celsius
    SMILES: N(N)C1=NC=CC=C1[N+](=O)[O-]
  2. 2-hydrazinyl-5-nitropyridine

    CAS No.: 6343-98-2
    Catalog No.: GS0029
    Purity: 95%
    MF: C5H6N4O2
    MW: 154.129
    Storage: 2-8 degree Celsius
    SMILES: N(N)C1=NC=C(C=C1)[N+](=O)[O-]
  3. 1-(5-methoxypyridin-2-yl)piperazine hydrochloride

    CAS No.: 1779124-05-8
    Catalog No.: GS0786
    Purity: 95%
    MF: C10H16ClN3O
    MW: 229.711
    Storage: 2-8 degree Celsius
    SMILES: Cl.COC=1C=CC(=NC1)N1CCNCC1
  4. 4-hydrazinylpicolinonitrile

    CAS No.: 1256585-86-0
    Catalog No.: GS1773
    Purity: 95%
    MF: C6H6N4
    MW: 134.142
    Storage: 2-8 degree Celsius
    SMILES: N(N)C1=CC(=NC=C1)C#N
  5. 3-fluoro-2-hydrazinyl-5-(trifluoromethyl)pyridine

    CAS No.: 1188265-25-9
    Catalog No.: GS1845
    Purity: 95%
    MF: C6H5F4N3
    MW: 195.119
    Storage: 2-8 degree Celsius
    SMILES: FC=1C(=NC=C(C1)C(F)(F)F)NN
  6. (2-isopropylpyridin-4-yl)boronic acid

    CAS No.: 1788062-08-7
    Catalog No.: GS2356
    Purity: 95%
    MF: C8H12BNO2
    MW: 165.001
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C1=NC=CC(=C1)B(O)O
  7. 6-isopropylpyridin-2-amine

    CAS No.: 78177-12-5
    Catalog No.: GS2389
    Purity: 95%
    MF: C8H12N2
    MW: 136.198
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C1=CC=CC(=N1)N
  8. 3-isopropylpyridine-2-sulfonamide

    CAS No.: 2089377-22-8
    Catalog No.: GS2416
    Purity: 95%
    MF: C8H12N2O2S
    MW: 200.263
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1C(=NC=CC1)S(=O)(=O)N
  9. 3-isopropyl-4-(piperidin-2-yl)pyridine

    CAS No.: 1889164-41-3
    Catalog No.: GS2440
    Purity: 95%
    MF: C13H20N2
    MW: 204.317
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1C=NC=CC1C1NCCCC1
  10. 5-isopropylpyridine-2-sulfonamide

    CAS No.: 179400-18-1
    Catalog No.: GS2471
    Purity: 95%
    MF: C8H12N2O2S
    MW: 200.263
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)C=1C=CC(=NC1)S(=O)(=O)N
Loading ...Load More ...
Set Ascending Direction

   

Items 51 to 60 of 4138 total

  1. 4
  2. 5
  3. 6
  4. 7
  5. 8