•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Pyrazolopyrazines

Set Ascending Direction

   

Items 41 to 50 of 53 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6
  1. tert-butyl 3-bromo-4H,5H,6H,7H-pyrazolo[1,5-a]pyrazine-5-carboxylate

    CAS No.: 1196154-25-2
    Catalog No.: 171490
    Purity: 95%
    MF: C11H16BrN3O2
    MW: 302.172
    Storage: 2-8 degree Celsius
    SMILES: CC(C)(C)OC(=O)N1CCN2N=CC(Br)=C2C1
  2. ethyl 2-iodo-4-oxo-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-3-carboxylate

    CAS No.: 1773507-49-5
    Catalog No.: 199239
    Purity: 95%
    MF: C9H10IN3O3
    MW: 335.101
    Storage: 2-8 degree Celsius
    SMILES: IC1=NN2C(C(NCC2)=O)=C1C(=O)OCC
  3. (4,5,6,7-Tetrahydropyrazolo[1,5-a]pyrazin-2-yl)methanol

    CAS No.: 623565-69-5
    Catalog No.: 199280
    Purity: 95%
    MF: C7H11N3O
    MW: 153.185
    Storage: 2-8 degree Celsius
    SMILES: N1=C(C=C2N1CCNC2)CO
  4. 2-(4-fluorophenyl)-6,7-dihydropyrazolo[1,5-a]pyrazin-4(5H)-one

    CAS No.: 1553968-38-9
    Catalog No.: 199292
    Purity: 95%
    MF: C12H10FN3O
    MW: 231.23
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)C1=NN2C(C(NCC2)=O)=C1
  5. tert-butyl 2-iodo-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate

    CAS No.: 1823835-34-2
    Catalog No.: 199307
    Purity: 95%
    MF: C11H16IN3O2
    MW: 349.172
    Storage: 2-8 degree Celsius
    SMILES: IC1=NN2C(CN(CC2)C(=O)OC(C)(C)C)=C1
  6. ethyl 4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine-2-carboxylate hydrochloride

    CAS No.: 2070015-34-6
    Catalog No.: 199604
    Purity: 95%
    MF: C9H14ClN3O2
    MW: 231.683
    Storage: 2-8 degree Celsius
    SMILES: Cl.N1=C(C=C2N1CCNC2)C(=O)OCC
  7. 1H-pyrazolo[3,4-b]pyrazin-3-amine

    CAS No.: 81411-64-5
    Catalog No.: 196112
    Purity: 95%
    MF: C5H5N5
    MW: 135.13
    Storage: 2-8 degree Celsius
    SMILES: N1N=C(C=2C1=NC=CN2)N
  8. tert-butyl 2-amino-6,7-dihydropyrazolo[1,5-a]pyrazine-5(4H)-carboxylate

    CAS No.: 1209487-56-8
    Catalog No.: 197650
    Purity: 95%
    MF: C11H18N4O2
    MW: 238.291
    Storage: 2-8 degree Celsius
    SMILES: NC1=NN2C(CN(CC2)C(=O)OC(C)(C)C)=C1
  9. 6,7-dihydro-2-phenylpyrazolo[1,5-a]pyrazin-4(5H)-one

    CAS No.: 1246552-68-0
    Catalog No.: 197651
    Purity: 95%
    MF: C12H11N3O
    MW: 213.24
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1=NN2C(C(NCC2)=O)=C1
  10. 2-(4-chlorophenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrazine

    CAS No.: 1250443-87-8
    Catalog No.: 197652
    Purity: 95%
    MF: C12H12ClN3
    MW: 233.702
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C1=NN2C(CNCC2)=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 41 to 50 of 53 total

  1. 2
  2. 3
  3. 4
  4. 5
  5. 6