•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Oxiranes

Set Ascending Direction

   

Items 31 to 32 of 32 total

  1. 1
  2. 2
  3. 3
  4. 4
  1. 1-((2-(2,4-difluorophenyl)oxiran-2-yl)methyl)-1H-1,2,4-triazole methanesulfonate

    CAS No.: 86386-77-8
    Catalog No.: TQR1089
    Purity: 95%
    MF: C12H13F2N3O4S
    MW: 333.316
    Storage: 2-8 degree Celsius
    SMILES: CS(=O)(=O)O.FC1=C(C=CC(=C1)F)C1(OC1)CN1N=CN=C1
  2. 1-((2-(2,4-dichlorophenyl)oxiran-2-yl)methyl)-1H-1,2,4-triazole

    CAS No.: 81886-66-0
    Catalog No.: TQR1067
    Purity: 95%
    MF: C11H9Cl2N3O
    MW: 270.119
    Storage: 2-8 degree Celsius
    SMILES: ClC1=C(C=CC(=C1)Cl)C1(OC1)CN1N=CN=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 31 to 32 of 32 total

  1. 1
  2. 2
  3. 3
  4. 4