•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Metabolic Enzyme/Protease

Set Ascending Direction

   

Items 21 to 29 of 29 total

  1. 1
  2. 2
  3. 3
  1. ATX inhibitor 1

    CAS No.: 2225892-70-4
    Catalog No.: WLZ3365
    Purity: 95%
    MF: C21H23Cl2N2O6P
    MW: 501.303
    Storage: 2-8 degree Celsius
    SMILES: ClC=1C=C(COC(=O)N2CCC(CC2)C(=O)NC2=CC=C(CP(O)(O)=O)C=C2)C=C(C1)Cl
  2. D609 potassium salt

    CAS No.: 83373-60-8
    Catalog No.: 198920
    Purity: 95%
    MF: C11H15KOS2
    MW: 266.472
    Storage: 2-8 degree Celsius
    SMILES: C(OC1C2C3CCCC3C(C1)C2)(=S)[S-].[K+]
  3. Dimethindene maleate

    CAS No.: 3614-69-5
    Catalog No.: 198913
    Purity: 95%
    MF: C24H28N2O4
    MW: 408.498
    Storage: 2-8 degree Celsius
    SMILES: C(\C=C/C(=O)O)(=O)O.CN(CCC=1CC2=CC=CC=C2C1C(C)C1=NC=CC=C1)C
  4. GNE-617

    CAS No.: 1362154-70-8
    Catalog No.: 157286
    Purity: 95%
    MF: C21H15F2N3O3S
    MW: 427.432
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC(=CC(F)=C1)S(=O)(=O)C1=CC=C(CNC(=O)C2=CN3C=CN=C3C=C2)C=C1
  5. Chlorogenic Acid

    CAS No.: 327-97-9
    Catalog No.: 151614
    Purity: 95%
    MF: C16H18O9
    MW: 354.311
    Storage: 2-8 degree Celsius
    SMILES: O[C@@H]1C[C@](O)(C[C@@H](OC(=O)\C=C\C2=CC(O)=C(O)C=C2)[C@@H]1O)C(O)=O
  6. PF-05180999

    CAS No.: 1394033-54-5
    Catalog No.: TQR1229
    Purity: 95%
    MF: C19H17F3N8
    MW: 414.395
    Storage: 2-8 degree Celsius
    SMILES: N1(CCC1)C1=NC=NN2C1=C(N=C2C)C=2C=NN(C2C2=NC=C(C=C2)C(F)(F)F)C
  7. FTI277 HCl

    CAS No.: 180977-34-8
    Catalog No.: 193770
    Purity: 95%
    MF: C22H30ClN3O3S2
    MW: 484.087
    Storage: 2-8 degree Celsius
    SMILES: Cl.N[C@H](CNC1=CC=C(C(=C1)C1=CC=CC=C1)C(=O)N[C@@H](CCSC)C(=O)OC)CS
  8. ML349

    CAS No.: 890819-86-0
    Catalog No.: 193697
    Purity: 95%
    MF: C23H22N2O4S2
    MW: 454.573
    Storage: 2-8 degree Celsius
    SMILES: O=S1(CC2=C(C=3C=CC=CC13)SC(=C2)C(=O)N2CCN(CC2)C2=CC=C(C=C2)OC)=O
  9. IMT1

    CAS No.: 2304621-31-4
    Catalog No.: 193680
    Purity: 95%
    MF: C21H21NO4
    MW: 351.402
    Storage: 2-8 degree Celsius
    SMILES: CN(C(C(C)OC1=CC=C2C(=CC(OC2=C1)=O)C1=C(C=CC=C1)C)=O)C
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 29 of 29 total

  1. 1
  2. 2
  3. 3