•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Epigenetics

Set Ascending Direction

   

Items 21 to 30 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. SGC-CBP30

    CAS No.: 1613695-14-9
    Catalog No.: 111890
    Purity: 95%
    MF: C28H33ClN4O3
    MW: 509.05
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC=C(CCC2=NC3=CC(=CC=C3N2C[C@H](C)N2CCOCC2)C2=C(C)ON=C2C)C=C1Cl
  2. MK-8628; OTX015; OTX-015

    CAS No.: 202590-98-5
    Catalog No.: 111949
    Purity: 95%
    MF: C25H22ClN5O2S
    MW: 492.004
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C)C2=C(S1)N1C(C)=NN=C1[C@H](CC(=O)NC1=CC=C(O)C=C1)N=C2C1=CC=C(Cl)C=C1
  3. (-)-JQ1; (R)-(-)-JQ1 Enantiomer

    CAS No.: 1268524-71-5
    Catalog No.: 112259
    Purity: 95%
    MF: C23H25ClN4O2S
    MW: 456.999
    Storage: 2-8 degree Celsius
    SMILES: CC1=C(C)C2=C(S1)N1C(C)=NN=C1[C@@H](CC(=O)OC(C)(C)C)N=C2C1=CC=C(Cl)C=C1
  4. GSK126; EZH2 inhibitor; GSK2816126A

    CAS No.: 1346574-57-9
    Catalog No.: 134447
    Purity: 95%
    MF: C31H38N6O2
    MW: 526.685
    Storage: 2-8 degree Celsius
    SMILES: CC[C@H](C)N1C=C(C)C2=C(C=C(C=C12)C1=CC=C(N=C1)N1CCNCC1)C(=O)NCC1=C(C)C=C(C)NC1=O
  5. 2,3-dibromo-6-fluoropyridine

    CAS No.: 1806295-40-8
    Catalog No.: 136427
    Purity: 95%
    MF: C5H2Br2FN
    MW: 254.884
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(Br)C(Br)=N1
  6. JQ-1 carboxylic acid

    CAS No.: 202592-23-2
    Catalog No.: 186491
    Purity: 95%
    MF: C19H17ClN4O2S
    MW: 400.891
    Storage: -20 degree Celsius
    SMILES: ClC1=CC=C(C=C1)C1=N[C@H](C=2N(C3=C1C(=C(S3)C)C)C(=NN2)C)CC(=O)O
  7. (2R,3R,4R,5R)-2-(Acetoxymethyl)-5-(4-amino-2-oxo-1,3,5-triazin-1(2H)-yl)tetrahydrofuran-3,4-diyl diacetate

    CAS No.: 10302-78-0
    Catalog No.: 198461
    Purity: 95%
    MF: C14H18N4O8
    MW: 370.318
    Storage: 2-8 degree Celsius
    SMILES: C(C)(=O)O[C@@H]1[C@H](O[C@H]([C@@H]1OC(C)=O)N1C(N=C(N=C1)N)=O)COC(C)=O
  8. CUDC-101

    CAS No.: 1012054-59-9
    Catalog No.: 104818
    Purity: 95%
    MF: C24H26N4O4
    MW: 434.496
    Storage: 2-8 degree Celsius
    SMILES: COC1=CC2=NC=NC(NC3=CC=CC(=C3)C#C)=C2C=C1OCCCCCCC(=O)NO
  9. BMS-P5

    CAS No.: 1550371-22-6
    Catalog No.: 193665
    Purity: 95%
    MF: C27H32N6O2
    MW: 472.593
    Storage: 2-8 degree Celsius
    SMILES: N[C@@H]1CC[C@@H](N(C1)C(=O)C1=CC2=C(N(C(=N2)C2=CC=3C(=NC=CC3)N2CC2CC2)C)C(=C1)OC)C
  10. WM-3835

    CAS No.: 2229025-70-9
    Catalog No.: 193688
    Purity: 95%
    MF: C20H17FN2O4S
    MW: 400.431
    Storage: 2-8 degree Celsius
    SMILES: FC1=C(C=C(C=C1C)C1=CC=CC=C1)C(=O)NNS(=O)(=O)C1=CC(=CC=C1)O
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 53 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5