•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Cyclopropanes

Set Descending Direction

   

Items 1 to 10 of 236 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. (1-methylcyclopropyl)methanamine hydrochloride

    CAS No.: 1260779-19-8
    Catalog No.: 193259
    Purity: 95%
    MF: C5H12ClN
    MW: 121.611
    Storage: 2-8 degree Celsius
    SMILES: Cl.CC1(CC1)CN
  2. 2-(4-fluorophenyl)cyclopropanecarboxamide

    CAS No.: 1374509-48-4
    Catalog No.: 193265
    Purity: 95%
    MF: C10H10FNO
    MW: 179.194
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)C1C(C1)C(=O)N
  3. (1S,2S)-2-(4-chlorophenyl)cyclopropanecarboxylic acid

    CAS No.: 142793-24-6
    Catalog No.: 193266
    Purity: 95%
    MF: C10H9ClO2
    MW: 196.633
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC=C(C=C1)[C@@H]1[C@H](C1)C(=O)O
  4. 1-methylcyclopropanecarboxamide

    CAS No.: 15910-91-5
    Catalog No.: 193267
    Purity: 95%
    MF: C5H9NO
    MW: 99.133
    Storage: 2-8 degree Celsius
    SMILES: CC1(CC1)C(=O)N
  5. (1R,2R)-2-(4-fluorophenyl)cyclopropanecarboxylic acid

    CAS No.: 161711-27-9
    Catalog No.: 193268
    Purity: 95%
    MF: C10H9FO2
    MW: 180.178
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)[C@H]1[C@@H](C1)C(=O)O
  6. Cis-methyl 2-(tert-butoxycarbonylamino)cyclopropanecarboxylate

    CAS No.: 170299-60-2
    Catalog No.: 193269
    Purity: 95%
    MF: C10H17NO4
    MW: 215.249
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@@H]1[C@@H](C1)C(=O)OC
  7. 2-(2-(trifluoromethyl)phenyl)cyclopropanamine hydrochloride

    CAS No.: 175168-77-1
    Catalog No.: 193270
    Purity: 95%
    MF: C10H11ClF3N
    MW: 237.652
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC(C1=C(C=CC=C1)C1C(C1)N)(F)F
  8. tert-Butyl ((1R,2R)-2-(hydroxymethyl)cyclopropyl)carbamate

    CAS No.: 177472-54-7
    Catalog No.: 193271
    Purity: 95%
    MF: C9H17NO3
    MW: 187.239
    Storage: 2-8 degree Celsius
    SMILES: OC[C@H]1[C@@H](C1)NC(OC(C)(C)C)=O
  9. cis-2-((tert-butoxycarbonyl)amino)cyclopropanecarboxylic acid

    CAS No.: 1810070-30-4
    Catalog No.: 193273
    Purity: 95%
    MF: C9H15NO4
    MW: 201.222
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N[C@@H]1[C@@H](C1)C(=O)O
  10. tert-butyl 1-(4-formylphenyl)cyclopropylcarbamate

    CAS No.: 1951439-73-8
    Catalog No.: 193275
    Purity: 95%
    MF: C15H19NO3
    MW: 261.321
    Storage: 2-8 degree Celsius
    SMILES: C(=O)C1=CC=C(C=C1)C1(CC1)NC(OC(C)(C)C)=O
Loading ...Load More ...
Set Descending Direction

   

Items 1 to 10 of 236 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5