•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Benzoimidazoles

Set Ascending Direction

   

Items 1 to 10 of 305 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 2-chloro-5,6-dimethyl-1H-benzo[d]imidazole

    CAS No.: 39791-96-3
    Catalog No.: TQP0914
    Purity: 95%
    MF: C9H9ClN2
    MW: 180.638
    Storage: 2-8 degree Celsius
    SMILES: ClC1=NC2=C(N1)C=C(C(=C2)C)C
  2. 5,6-dichloro-1-(piperidin-4-yl)-1H-benzo[d]imidazol-2(3H)-one

    CAS No.: 58859-51-1
    Catalog No.: TQP0917
    Purity: 95%
    MF: C12H13Cl2N3O
    MW: 286.162
    Storage: 2-8 degree Celsius
    SMILES: ClC1=CC2=C(N(C(N2)=O)C2CCNCC2)C=C1Cl
  3. ethyl 5-bromo-1H-benzo[d]imidazole-7-carboxylate

    CAS No.: 1100218-00-5
    Catalog No.: TQR0393
    Purity: 95%
    MF: C10H9BrN2O2
    MW: 269.098
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC2=C(NC=N2)C(=C1)C(=O)OCC
  4. ethyl 6-bromo-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-benzo[d]imidazole-4-carboxylate

    CAS No.: 1100218-02-7
    Catalog No.: TQR0394
    Purity: 95%
    MF: C16H23BrN2O3Si
    MW: 399.361
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C=C(C2=C(N(C=N2)COCC[Si](C)(C)C)C1)C(=O)OCC
  5. morpholino(6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-((2-(trimethylsilyl)ethoxy)methyl)-1H-benzo[d]imidazol-4-yl)methanone

    CAS No.: 1926990-95-5
    Catalog No.: TQR0395
    Purity: 95%
    MF: C24H38BN3O5Si
    MW: 487.482
    Storage: 2-8 degree Celsius
    SMILES: O1CCN(CC1)C(=O)C1=CC(=CC=2N(C=NC21)COCC[Si](C)(C)C)B2OC(C(O2)(C)C)(C)C
  6. methyl 4-bromo-1H-benzo[d]imidazole-6-carboxylate

    CAS No.: 1354756-19-6
    Catalog No.: TQR0399
    Purity: 95%
    MF: C9H7BrN2O2
    MW: 255.071
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC(=CC=2NC=NC21)C(=O)OC
  7. methyl 2-(2-(4-aminophenyl)-1H-benzo[d]imidazol-6-yl)acetate

    CAS No.: 2244886-11-9
    Catalog No.: TQR0400
    Purity: 95%
    MF: C16H15N3O2
    MW: 281.315
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC=C(C=C1)C1=NC2=C(N1)C=C(C=C2)CC(=O)OC
  8. methyl 2-(2-(4-amino-3-fluorophenyl)-1H-benzo[d]imidazol-6-yl)acetate

    CAS No.: 2244894-04-8
    Catalog No.: TQR0401
    Purity: 95%
    MF: C16H14FN3O2
    MW: 299.305
    Storage: 2-8 degree Celsius
    SMILES: NC1=C(C=C(C=C1)C1=NC2=C(N1)C=C(C=C2)CC(=O)OC)F
  9. (6-(methoxycarbonyl)-1H-benzo[d]imidazol-4-yl)boronic acid

    CAS No.: 1926991-21-0
    Catalog No.: TQR0819
    Purity: 95%
    MF: C9H9BN2O4
    MW: 219.993
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)C=1C=C(C2=C(NC=N2)C1)B(O)O
  10. 5-amino-1-ethyl-1H-benzo[d]imidazol-2(3H)-one

    CAS No.: 223745-04-8
    Catalog No.: TQR1741
    Purity: 95%
    MF: C9H11N3O
    MW: 177.207
    Storage: 2-8 degree Celsius
    SMILES: NC1=CC2=C(N(C(N2)=O)CC)C=C1
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 305 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5