•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Azetidines

Set Ascending Direction

   

Items 1 to 10 of 404 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. 3-(4-chlorophenyl)azetidine hydrochloride

    CAS No.: 7606-31-7
    Catalog No.: GS0563
    Purity: 95%
    MF: C9H11Cl2N
    MW: 204.1
    Storage: 2-8 degree Celsius
    SMILES: Cl.ClC1=CC=C(C=C1)C1CNC1
  2. 3-(4-fluoro-2-methylphenyl)azetidine

    CAS No.: 1260855-55-7
    Catalog No.: GS3589
    Purity: 95%
    MF: C10H12FN
    MW: 165.211
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC(=C(C=C1)C1CNC1)C
  3. 3-(2-methoxy-5-(trifluoromethyl)phenyl)azetidine

    CAS No.: 1260644-03-8
    Catalog No.: GS3649
    Purity: 95%
    MF: C11H12F3NO
    MW: 231.217
    Storage: 2-8 degree Celsius
    SMILES: COC1=C(C=C(C=C1)C(F)(F)F)C1CNC1
  4. 3-(azetidin-3-yl)-4-chlorobenzoic acid

    CAS No.: 1260643-14-8
    Catalog No.: GS3662
    Purity: 95%
    MF: C10H10ClNO2
    MW: 211.648
    Storage: 2-8 degree Celsius
    SMILES: N1CC(C1)C=1C=C(C(=O)O)C=CC1Cl
  5. tert-butyl 3-(3-cyano-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)azetidine-1-carboxylate

    CAS No.: 1451390-84-3
    Catalog No.: GS3766
    Purity: 95%
    MF: C21H29BN2O4
    MW: 384.285
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C=1C=C(C=C(C1)B1OC(C(O1)(C)C)(C)C)C1CN(C1)C(=O)OC(C)(C)C
  6. 2-(1-(tert-butoxycarbonyl)azetidin-3-yl)benzoic acid

    CAS No.: 908334-12-3
    Catalog No.: GS3772
    Purity: 95%
    MF: C15H19NO4
    MW: 277.32
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N1CC(C1)C1=C(C(=O)O)C=CC=C1
  7. tert-butyl 3-(3-aminophenyl)azetidine-1-carboxylate

    CAS No.: 916421-38-0
    Catalog No.: GS3773
    Purity: 95%
    MF: C14H20N2O2
    MW: 248.326
    Storage: 2-8 degree Celsius
    SMILES: NC=1C=C(C=CC1)C1CN(C1)C(=O)OC(C)(C)C
  8. 3-(1-(tert-butoxycarbonyl)azetidin-3-yl)benzoic acid

    CAS No.: 908334-11-2
    Catalog No.: GS3780
    Purity: 95%
    MF: C15H19NO4
    MW: 277.32
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)N1CC(C1)C=1C=C(C(=O)O)C=CC1
  9. tert-butyl 3-(6-fluoropyridin-3-yl)azetidine-1-carboxylate

    CAS No.: 1801986-14-0
    Catalog No.: GS3800
    Purity: 95%
    MF: C13H17FN2O2
    MW: 252.289
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=N1)C1CN(C1)C(=O)OC(C)(C)C
  10. tert-butyl 3-(3-bromopyridin-2-yl)azetidine-1-carboxylate

    CAS No.: 1349873-31-9
    Catalog No.: GS3810
    Purity: 95%
    MF: C13H17BrN2O2
    MW: 313.195
    Storage: 2-8 degree Celsius
    SMILES: BrC=1C(=NC=CC1)C1CN(C1)C(=O)OC(C)(C)C
Loading ...Load More ...
Set Ascending Direction

   

Items 1 to 10 of 404 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5