•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Alicyclics

Set Ascending Direction

   

Items 61 to 70 of 1962 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9
  1. 2-(3-(trifluoromethyl)phenyl)cyclopropan-1-amine hydrochloride

    CAS No.: 2711-56-0
    Catalog No.: 193279
    Purity: 95%
    MF: C10H11ClF3N
    MW: 237.652
    Storage: 2-8 degree Celsius
    SMILES: Cl.FC(C=1C=C(C=CC1)C1C(C1)N)(F)F
  2. cis-2-methoxycarbonylcyclopropanecarboxylic acid

    CAS No.: 31420-47-0
    Catalog No.: 193281
    Purity: 95%
    MF: C6H8O4
    MW: 144.126
    Storage: 2-8 degree Celsius
    SMILES: COC(=O)[C@@H]1[C@@H](C1)C(=O)O
  3. (1R,2R)-2-(4-bromophenyl)cyclopropanecarboxylic acid

    CAS No.: 31501-85-6
    Catalog No.: 193282
    Purity: 95%
    MF: C10H9BrO2
    MW: 241.084
    Storage: 2-8 degree Celsius
    SMILES: BrC1=CC=C(C=C1)[C@H]1[C@@H](C1)C(=O)O
  4. (1R,2R)-2-phenylcyclopropanecarboxylic acid

    CAS No.: 3471-10-1
    Catalog No.: 193284
    Purity: 95%
    MF: C10H10O2
    MW: 162.188
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)[C@H]1[C@@H](C1)C(=O)O
  5. 1-cyclopropyl-2-hydroxyethanone

    CAS No.: 42251-78-5
    Catalog No.: 193285
    Purity: 95%
    MF: C5H8O2
    MW: 100.117
    Storage: 2-8 degree Celsius
    SMILES: C1(CC1)C(CO)=O
  6. tert-butyl 1-cyanocyclopropylcarbamate

    CAS No.: 507264-68-8
    Catalog No.: 193286
    Purity: 95%
    MF: C9H14N2O2
    MW: 182.223
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C1(CC1)NC(OC(C)(C)C)=O
  7. (1S,2S)-2-(4-fluorophenyl)cyclopropanecarboxylic acid

    CAS No.: 515179-19-8
    Catalog No.: 193287
    Purity: 95%
    MF: C10H9FO2
    MW: 180.178
    Storage: 2-8 degree Celsius
    SMILES: FC1=CC=C(C=C1)[C@@H]1[C@H](C1)C(=O)O
  8. trans-2-(benzyloxycarbonyl)cyclopropanecarboxylic acid

    CAS No.: 53229-64-4
    Catalog No.: 193288
    Purity: 95%
    MF: C12H12O4
    MW: 220.224
    Storage: 2-8 degree Celsius
    SMILES: C(C1=CC=CC=C1)OC(=O)[C@H]1[C@@H](C1)C(=O)O
  9. 3-Cyclopropyl-2-propenoic acid ethyl ester

    CAS No.: 5808-99-1
    Catalog No.: 193290
    Purity: 95%
    MF: C8H12O2
    MW: 140.182
    Storage: 2-8 degree Celsius
    SMILES: C(C)OC(C=CC1CC1)=O
  10. (2-phenylcyclopropyl)methanol

    CAS No.: 61826-40-2
    Catalog No.: 193291
    Purity: 95%
    MF: C10H12O
    MW: 148.205
    Storage: 2-8 degree Celsius
    SMILES: C1(=CC=CC=C1)C1C(C1)CO
Loading ...Load More ...
Set Ascending Direction

   

Items 61 to 70 of 1962 total

  1. 5
  2. 6
  3. 7
  4. 8
  5. 9