•  
SSL
0item(s)

You have no items in your shopping cart.

Product was successfully added to your shopping cart.

Alicyclics

Set Ascending Direction

   

Items 21 to 30 of 1962 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5
  1. tert-butyl 8-amino-5-azaspiro[3.5]nonane-5-carboxylate

    CAS No.: 778646-91-6
    Catalog No.: 193226
    Purity: 95%
    MF: C13H24N2O2
    MW: 240.347
    Storage: 2-8 degree Celsius
    SMILES: NC1CCN(C2(CCC2)C1)C(=O)OC(C)(C)C
  2. ethyl 2-(1-aminocyclobutyl)acetate

    CAS No.: 1199780-20-5
    Catalog No.: 193228
    Purity: 95%
    MF: C8H15NO2
    MW: 157.213
    Storage: 2-8 degree Celsius
    SMILES: NC1(CCC1)CC(=O)OCC
  3. 3-amino-3-(4-methoxyphenyl)cyclobutanol

    CAS No.: 1353636-82-4
    Catalog No.: 193229
    Purity: 95%
    MF: C11H15NO2
    MW: 193.246
    Storage: 2-8 degree Celsius
    SMILES: NC1(CC(C1)O)C1=CC=C(C=C1)OC
  4. 3-amino-3-(4-chlorophenyl)cyclobutanol

    CAS No.: 1353636-85-7
    Catalog No.: 193230
    Purity: 95%
    MF: C10H12ClNO
    MW: 197.665
    Storage: 2-8 degree Celsius
    SMILES: NC1(CC(C1)O)C1=CC=C(C=C1)Cl
  5. 3-hydroxy-1-(4-methoxyphenyl)cyclobutanecarboxylic acid

    CAS No.: 1353636-86-8
    Catalog No.: 193231
    Purity: 95%
    MF: C12H14O4
    MW: 222.24
    Storage: 2-8 degree Celsius
    SMILES: OC1CC(C1)(C(=O)O)C1=CC=C(C=C1)OC
  6. 2-(1-(tert-butoxycarbonyl)cyclobutyl)acetic acid

    CAS No.: 249762-02-5
    Catalog No.: 193232
    Purity: 95%
    MF: C11H18O4
    MW: 214.261
    Storage: 2-8 degree Celsius
    SMILES: C(C)(C)(C)OC(=O)C1(CCC1)CC(=O)O
  7. 1-cyanocyclobutanecarboxylic acid

    CAS No.: 30491-91-9
    Catalog No.: 193233
    Purity: 95%
    MF: C6H7NO2
    MW: 125.127
    Storage: 2-8 degree Celsius
    SMILES: C(#N)C1(CCC1)C(=O)O
  8. 2-(1-aminocyclobutyl)acetic acid hydrochloride

    CAS No.: 58885-90-8
    Catalog No.: 193234
    Purity: 95%
    MF: C6H12ClNO2
    MW: 165.62
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1(CCC1)CC(=O)O
  9. cis-1-(4-chlorophenyl)-3-hydroxycyclobutanecarboxylic acid

    CAS No.: 933469-83-1
    Catalog No.: 193235
    Purity: 95%
    MF: C11H11ClO3
    MW: 226.659
    Storage: 2-8 degree Celsius
    SMILES: O=C([C@@]1(C2=CC=C(Cl)C=C2)C[C@@H](O)C1)O
  10. 3-amino-3-(4-methoxyphenyl)cyclobutanol hydrochloride

    CAS No.: 2665663-20-5
    Catalog No.: 193237
    Purity: 95%
    MF: C11H16ClNO2
    MW: 229.707
    Storage: 2-8 degree Celsius
    SMILES: Cl.NC1(CC(C1)O)C1=CC=C(C=C1)OC
Loading ...Load More ...
Set Ascending Direction

   

Items 21 to 30 of 1962 total

  1. 1
  2. 2
  3. 3
  4. 4
  5. 5