tert-butyl N-[cis-3-methylpiperidin-4-yl]carbamate
$250.00
CAS No.: 473839-06-4
Catalog No.: 170264
Purity: 95%
MF: C11H22N2O2
MW: 214.309
Storage: 2-8 degree Celsius
SMILES: C[C@H]1CNCC[C@H]1NC(=O)OC(C)(C)C
Catalog No.: 170264
Purity: 95%
MF: C11H22N2O2
MW: 214.309
Storage: 2-8 degree Celsius
SMILES: C[C@H]1CNCC[C@H]1NC(=O)OC(C)(C)C
tert-butyl N-[cis-3-methylpiperidin-4-yl]carbamate; CAS No.: 473839-06-4; tert-butyl N-[cis-3-methylpiperidin-4-yl]carbamate illustrates ChemShuttle's building blocks for drug discovery. As a custom chemical synthesis company, we provide protected piperidine derivatives with methyl substitution for research. This compound combines a cis-methyl group with a tert-butyl carbamate-protected amine on a piperidine ring, providing interesting steric properties. ChemShuttle's chemical synthesis expertise ensures precise substitution and high purity. The protected amine allows for controlled deprotection and further conjugation, making this compound valuable in peptide synthesis and medicinal chemistry.
Reviews
Write Your Own Review