tert-butyl 4-cyanophenylcarbamate
$200.00
CAS No.: 143090-18-0
Catalog No.: 188940
Purity: 95%
MF: C12H14N2O2
MW: 218.256
Storage: 2-8 degree Celsius
SMILES: C(#N)C1=CC=C(C=C1)NC(OC(C)(C)C)=O
Catalog No.: 188940
Purity: 95%
MF: C12H14N2O2
MW: 218.256
Storage: 2-8 degree Celsius
SMILES: C(#N)C1=CC=C(C=C1)NC(OC(C)(C)C)=O
tert-butyl 4-cyanophenylcarbamate; CAS No.: 143090-18-0; tert-butyl 4-cyanophenylcarbamate exemplifies the cyanogenic building blocks category within Chem Shuttle's product offerings. As a leading chemicals distributor, Chem Shuttle provides access to carbamate derivatives that incorporate nitrile groups, crucial for the synthesis of various pharmaceuticals and specialty chemicals. This compound, with its tert-butyl protecting group and cyanophenyl substituent, serves as a valuable intermediate in the production of cyanogenic pharmaceuticals and agrochemicals. Chem Shuttle's custom compound synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity, precisely specified tert-butyl 4-cyanophenylcarbamate, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review