(S)-(+)-2-phenylpropionic acid
$368.00
CAS No.: 7782-24-3
Catalog No.: 109217
Purity: 95%
MF: C9H10O2
MW: 150.177
Storage: 2-8 degree Celsius
SMILES: C[C@H](C(O)=O)C1=CC=CC=C1
Catalog No.: 109217
Purity: 95%
MF: C9H10O2
MW: 150.177
Storage: 2-8 degree Celsius
SMILES: C[C@H](C(O)=O)C1=CC=CC=C1
For R&D use only. Not for human or animal use.
(S)-(+)-2-phenylpropionic acid; CAS No.: 7782-24-3; (S)-(+)-2-phenylpropionic acid is recognized as a chemical building block within ChemShuttle's product portfolio. This classification underscores its role in the construction of more complex chemical compounds, providing a specific structural component that can be incorporated into various synthetic pathways. As a chemical building block, this compound offers researchers a versatile starting point for creating new molecules. ChemShuttle's focus on high-quality chemical building blocks ensures that products like (S)-(+)-2-phenylpropionic acid meet exacting standards for purity and reactivity. The compound's CAS No.: 7782-24-3 allows customers to accurately identify this specific building block within the company's offerings. By supplying such chemical building blocks, ChemShuttle supports diverse research applications, from pharmaceutical development to materials science. Researchers can depend on ChemShuttle's chemical building blocks to provide reliable starting points for their synthetic endeavors, knowing that each block undergoes rigorous quality control to ensure consistency and performance in subsequent chemical reactions.
Reviews
Write Your Own Review