VHL ligand 2 hydrochloride; E3 ligase Ligand 1A HCl
$400.00
CAS No.: 1948273-03-7
Catalog No.: ZB0749
Purity: 95%
MF: C23H33ClN4O3S
MW: 481.062
Storage: 2-8 degree Celsius
SMILES: O=C([C@H]1N(C([C@@H](N)C(C)(C)C)=O)C[C@H](O)C1)N[C@H](C2=CC=C(C3=C(C)N=CS3)C=C2)C.[H]Cl
Catalog No.: ZB0749
Purity: 95%
MF: C23H33ClN4O3S
MW: 481.062
Storage: 2-8 degree Celsius
SMILES: O=C([C@H]1N(C([C@@H](N)C(C)(C)C)=O)C[C@H](O)C1)N[C@H](C2=CC=C(C3=C(C)N=CS3)C=C2)C.[H]Cl
(2S,4R)-1-((S)-2-amino-3,3-dimethylbutanoyl)-4-hydroxy-N-((S)-1-(4-(4-methylthiazol-5-yl)phenyl)ethyl)pyrrolidine-2-carboxamide hydrochloride; CAS No.: 1948273-03-7: This substance is employed in the development of advanced materials. Its physical properties, such as its high surface area, make it suitable for use in catalysts and other high-performance materials.
Reviews
Write Your Own Review