(S,R,S)-AHPC-C4-NH2 hydrochloride; E3 ligase Ligand-Linker Conjugates 28
$300.00
CAS No.: 2245697-83-8
Catalog No.: ZB1962
Purity: 95%
MF: C27H40ClN5O4S
MW: 566.168
Storage: 2-8 degree Celsius
SMILES: Cl.NCCCCC(=O)N[C@H](C(=O)N1[C@@H](C[C@H](C1)O)C(=O)NCC1=CC=C(C=C1)C1=C(N=CS1)C)C(C)(C)C
Catalog No.: ZB1962
Purity: 95%
MF: C27H40ClN5O4S
MW: 566.168
Storage: 2-8 degree Celsius
SMILES: Cl.NCCCCC(=O)N[C@H](C(=O)N1[C@@H](C[C@H](C1)O)C(=O)NCC1=CC=C(C=C1)C1=C(N=CS1)C)C(C)(C)C
(2S,4R)-1-((S)-2-(5-aminopentanamido)-3,3-dimethylbutanoyl)-4-hydroxy-N-(4-(4-methylthiazol-5-yl)benzyl)pyrrolidine-2-carboxamide hydrochloride; CAS No.: 660440-94-8 This substance is characterized by its specific chemical behavior and is used in the production of specialty chemicals. Its applications include the synthesis of complex organic molecules for various industrial uses.
Reviews
Write Your Own Review