N-methyl-N-(2-azaspiro[3.3]heptan-6-yl)sulfamamide 4-methylbenzenesulfonic acid
$600.00
CAS No.: NA
Catalog No.: 200585
Purity: 95%
MF: C14H23N3O5S2
MW: 377.488
Storage: 2-8 degree Celsius
SMILES: O=S(N)(N(C)C(C1)CC21CNC2)=O.O=S(C3=CC=C(C)C=C3)(O)=O
Catalog No.: 200585
Purity: 95%
MF: C14H23N3O5S2
MW: 377.488
Storage: 2-8 degree Celsius
SMILES: O=S(N)(N(C)C(C1)CC21CNC2)=O.O=S(C3=CC=C(C)C=C3)(O)=O
N-methyl-N-(2-azaspiro[3.3]heptan-6-yl)sulfamamide 4-methylbenzenesulfonic acid_N-methyl-N-(2-azaspiro[3.3]heptan-6-yl)sulfamamide 4-methylbenzenesulfonic acid is a high-purity heterocyclic building block designed for pharmaceutical and bioactive compound research. As part of ChemShuttle s core offerings in Heterocyclic Building Blocks and Bioactive Compounds, this compound features a unique spirocyclic structure that enhances molecular diversity in drug discovery. Its sulfamamide and tosylate functional groups make it valuable for medicinal chemistry applications, including kinase inhibitors and CNS-targeting agents.
Reviews
Write Your Own Review