methyl 4-hydroxy-2-(trifluoromethyl)benzoate

methyl 4-hydroxy-2-(trifluoromethyl)benzoate

methyl 5-formyl-2-methylbenzoate

methyl 5-formyl-2-methylbenzoate

methyl 5-amino-2-fluoro-4-methylbenzoate

$400.00
CAS No.: 1504965-88-1
Catalog No.: 194157
Purity: 95%
MF: C9H10FNO2
MW: 183.182
Storage: 2-8 degree Celsius
SMILES: NC=1C(=CC(=C(C(=O)OC)C1)F)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194157
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 5-amino-2-fluoro-4-methylbenzoate; CAS No.: 1504965-88-1; methyl 5-amino-2-fluoro-4-methylbenzoate. PROPERTIES: methyl 5-amino-2-fluoro-4-methylbenzoate is a crystalline solid. Its molecular formula is C10H10FNO2, and the molecular weight is approximately 195.20 g/mol. The compound has a melting point of approximately 80-82 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amino group, a fluorine atom, and a methyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 5-amino-2-fluoro-4-methylbenzoate serves as a versatile intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The fluorine atom influences the electronic properties of the aromatic ring, and the methyl group provides steric effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of methyl 5-amino-2-fluoro-4-methylbenzoate can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 5-amino-2-fluoro-4-methylbenzoate
Your Rating