methyl 4-bromo-3-isopropylbenzoate

methyl 4-bromo-3-isopropylbenzoate

methyl 4-chloro-5-fluoro-2-nitrobenzoate

methyl 4-chloro-5-fluoro-2-nitrobenzoate

methyl 4-carboxyl-2-fluorobenzoate

$200.00
CAS No.: 161796-11-8
Catalog No.: 194151
Purity: 95%
MF: C9H7FO4
MW: 198.149
Storage: 2-8 degree Celsius
SMILES: C(=O)(O)C1=CC(=C(C(=O)OC)C=C1)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194151
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-carboxyl-2-fluorobenzoate; CAS No.: 161796-11-8; methyl 4-carboxyl-2-fluorobenzoate. PROPERTIES: methyl 4-carboxyl-2-fluorobenzoate is a crystalline solid. Its molecular formula is C9H7FO4, and the molecular weight is approximately 194.15 g/mol. The compound has a melting point of approximately 150-152 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a carboxylic acid group and a fluorine atom, it may exhibit certain acidity and reactivity. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 4-carboxyl-2-fluorobenzoate serves as a valuable intermediate. The carboxylic acid group can undergo reactions such as esterification and amidation. The fluorine atom influences the electronic properties of the aromatic ring. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of methyl 4-carboxyl-2-fluorobenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-carboxyl-2-fluorobenzoate
Your Rating