perchlorothiophene

perchlorothiophene

(E)-3-(5-nitrofuran-2-yl)acrylaldehyde

(E)-3-(5-nitrofuran-2-yl)acrylaldehyde

methyl 4-bromo-5-nitrothiophene-2-carboxylate

$325.00
CAS No.: 31862-80-3
Catalog No.: 194524
Purity: 95%
MF: C6H4BrNO4S
MW: 266.072
Storage: 2-8 degree Celsius
SMILES: COC(=O)C=1SC(=C(C1)Br)[N+](=O)[O-]
Availability:
In stock
SKU
194524
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-bromo-5-nitrothiophene-2-carboxylate; CAS No.: 31862-80-3; methyl 4-bromo-5-nitrothiophene-2-carboxylate. PROPERTIES: methyl 4-bromo-5-nitrothiophene-2-carboxylate is a crystalline solid. Its molecular formula is C6H5BrN2O3S, and the molecular weight is approximately 270.04 g/mol. The compound has a melting point of approximately 80-82 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a thiophene ring, a bromo group, a nitro group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4-bromo-5-nitrothiophene-2-carboxylate serves as a versatile intermediate. The bromo group provides a site for substitution or coupling reactions. The nitro group can be reduced to an amine group. The ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 4-bromo-5-nitrothiophene-2-carboxylate can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-bromo-5-nitrothiophene-2-carboxylate
Your Rating