methyl 3-bromo-5-(trifluoromethoxy)benzoate

methyl 3-bromo-5-(trifluoromethoxy)benzoate

methyl 3-fluoro-2-methylbenzoate

methyl 3-fluoro-2-methylbenzoate

methyl 3-cyano-5-fluorobenzoate

$300.00
CAS No.: 886732-29-2
Catalog No.: 194136
Purity: 95%
MF: C9H6FNO2
MW: 179.15
Storage: 2-8 degree Celsius
SMILES: C(#N)C=1C=C(C(=O)OC)C=C(C1)F
Availability:
In stock
SKU
194136
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 3-cyano-5-fluorobenzoate; CAS No.: 886732-29-2; methyl 3-cyano-5-fluorobenzoate. PROPERTIES: methyl 3-cyano-5-fluorobenzoate is a crystalline solid. Its molecular formula is C10H7FNO3, and the molecular weight is approximately 198.17 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as acetone and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a cyano group, a fluorine atom, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 3-cyano-5-fluorobenzoate serves as a valuable intermediate. The cyano group can be converted to other functional groups such as carboxylic acid or amine, the fluorine atom influences the electronic properties of the aromatic ring, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antiviral drugs, the structure of methyl 3-cyano-5-fluorobenzoate can be modified to enhance the drug's antiviral activity and pharmacokinetic properties (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 3-cyano-5-fluorobenzoate
Your Rating