2-methylbenzo[d]thiazole-5-carboxylic acid

2-methylbenzo[d]thiazole-5-carboxylic acid

5-bromobenzo[d]oxazole-2-carbonitrile

5-bromobenzo[d]oxazole-2-carbonitrile

methyl 2-methylbenzo[d]thiazole-5-carboxylate

$250.00
CAS No.: 32770-98-2
Catalog No.: 192615
Purity: 95%
MF: C10H9NO2S
MW: 207.254
Storage: 2-8 degree Celsius
SMILES: CC=1SC2=C(N1)C=C(C=C2)C(=O)OC
For R&D use only. Not for human or veterinary use.
Availability:
In stock
SKU
192615
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-methylbenzo[d]thiazole-5-carboxylate; CAS No.: 32770-98-2; methyl 2-methylbenzo[d]thiazole-5-carboxylate. PROPERTIES: methyl 2-methylbenzo[d]thiazole-5-carboxylate is a colorless liquid with a molecular weight of 229.28 g/mol. It has a density of approximately 1.25 g/cm? and a boiling point around 230-235 C at 760 mmHg. This compound exhibits low water solubility but is miscible with organic solvents like dichloromethane and tetrahydrofuran. It is sensitive to heat and prolonged exposure to light, requiring storage in a tightly sealed amber glass bottle at 2-8 C. Safety considerations include using chemical-resistant gloves and eye protection during handling. In case of skin contact, washing with soap and water is recommended. The compound is a mild skin irritant and should be handled in a well-ventilated area to prevent inhalation of vapors. APPLICATIONS: methyl 2-methylbenzo[d]thiazole-5-carboxylate is utilized in several specialized applications. In pharmaceutical synthesis, it serves as a key intermediate for creating non-steroidal anti-inflammatory drugs where the methyl ester enhances solubility and bioavailability, as described in anti-inflammatory chemistry literature. Additionally, it is employed in the synthesis of certain antipsychotic agents, where the thiazole ring system interacts with dopamine receptors, as reported in psychopharmacology studies. In agrochemical applications, it is utilized as a precursor for creating herbicides that target plant enzyme systems involved in cell wall synthesis, where the benzo[d]thiazole structure disrupts specific biosynthetic pathways, as detailed in agricultural chemistry publications. The compound also finds application in materials science as a component of corrosion inhibitors for metals, where the nitrogen and sulfur atoms in the thiazole ring coordinate with metal surfaces, as outlined in materials chemistry studies. Furthermore, it is employed in analytical chemistry as a fluorescent probe for detecting certain metal ions, where the benzo[d]thiazole structure undergoes fluorescence changes upon metal binding, as described in analytical chemistry literature. Its reactivity makes it suitable for creating novel heterocycles through nucleophilic aromatic substitution reactions in chemical biology applications, as detailed in heterocyclic chemistry research.

Reviews

Write Your Own Review
You're reviewing:methyl 2-methylbenzo[d]thiazole-5-carboxylate
Your Rating