methyl 2-chloro-6-methoxybenzoate

methyl 2-chloro-6-methoxybenzoate

methyl 2-fluoro-3-formylbenzoate

methyl 2-fluoro-3-formylbenzoate

methyl 2-cyano-5-methylbenzoate

$300.00
CAS No.: 127510-94-5
Catalog No.: 194125
Purity: 95%
MF: C10H9NO2
MW: 175.187
Storage: 2-8 degree Celsius
SMILES: C(#N)C1=C(C(=O)OC)C=C(C=C1)C
Availability:
In stock
SKU
194125
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-cyano-5-methylbenzoate; CAS No.: 127510-94-5; methyl 2-cyano-5-methylbenzoate. PROPERTIES: methyl 2-cyano-5-methylbenzoate is a crystalline solid. Its molecular formula is C11H9NO3, and the molecular weight is approximately 203.19 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as acetone and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a cyano group, a methyl group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, methyl 2-cyano-5-methylbenzoate serves as a valuable intermediate. The cyano group can be converted to other functional groups such as carboxylic acid or amine, the methyl group provides steric effects, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of methyl 2-cyano-5-methylbenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2-cyano-5-methylbenzoate
Your Rating