(4aS,9bR)-6-bromo-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole (S)-2-hydroxy-2-phenylacetic acid

(4aS,9bR)-6-bromo-2,3,4,4a,5,9b-hexahydro-1H-pyrido[4,3-b]indole (S)-2-hydroxy-2-phenylacetic acid

4-morpholinoaniline

4-morpholinoaniline

methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate

$200.00
CAS No.: 22955-77-7
Catalog No.: 194274
Purity: 95%
MF: C11H10O3
MW: 190.198
Storage: 2-8 degree Celsius
SMILES: O=C1C(CC2=CC=CC=C12)C(=O)OC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194274
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate; CAS No.: 22955-77-7; methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate. PROPERTIES: methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate is a crystalline solid. Its molecular formula is C11H9NO3, and the molecular weight is approximately 203.19 g/mol. The compound has a melting point of approximately 75-77 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an indene ring, a ketone group, and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate serves as a versatile intermediate. The ester group can be hydrolyzed to a carboxylic acid. The ketone group provides opportunities for further functionalization. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate can be modified to enhance the drug's efficacy and reduce side effects (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 1-oxo-2,3-dihydro-1H-indene-2-carboxylate
Your Rating