![1-azabicyclo[2.2.2]octane-4-carboxylic acid hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/170318_1.jpg)
methyl 1-methyl-4-nitro-1H-pyrazole-3-carboxylate
$250.00
CAS No.: 400877-57-8
Catalog No.: 170319
Purity: 95%
MF: C6H7N3O4
MW: 185.139
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=NN(C)C=C1[N+]([O-])=O
Catalog No.: 170319
Purity: 95%
MF: C6H7N3O4
MW: 185.139
Storage: 2-8 degree Celsius
SMILES: COC(=O)C1=NN(C)C=C1[N+]([O-])=O
methyl 1-methyl-4-nitro-1H-pyrazole-3-carboxylate; CAS No.: 400877-57-8; methyl 1-methyl-4-nitro-1H-pyrazole-3-carboxylate is part of ChemShuttle's screening compounds collection. As a leading chemicals distributor, we specialize in providing diverse chemical building blocks for drug discovery. Our CRO chemical synthesis services enable the production of complex molecules tailored to specific research needs. Researchers benefit from our extensive library of compounds, which includes various organic chemicals and heterocycles. We emphasize quality and reliability, ensuring each compound meets high purity standards. ChemShuttle's expertise in chemical synthesis supports scientific advancements by supplying essential chemicals for experimentation and development.
Reviews
Write Your Own Review