![8-bromo-6-fluoro-[1,2,4]triazolo[1,5-a]pyridin-2-amine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/199281_1.jpg)
![6-bromo-3-methyl-[1,2,4]triazolo[4,3-a]pyridine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/199302_1.jpg)
2,6-dibromo-[1,2,4]triazolo[1,5-a]pyridine
$400.00
CAS No.: 1401624-81-4
Catalog No.: 199283
Purity: 95%
MF: C6H3Br2N3
MW: 276.919
Storage: 2-8 degree Celsius
SMILES: BrC1=NN2C(C=CC(=C2)Br)=N1
Catalog No.: 199283
Purity: 95%
MF: C6H3Br2N3
MW: 276.919
Storage: 2-8 degree Celsius
SMILES: BrC1=NN2C(C=CC(=C2)Br)=N1
CAS No.: 1401624-81-4; 2,6-dibromo-[1,2,4]triazolo[1,5-a]pyridine is an essential component of ChemShuttle's screening compounds collection. This compound offers unique reactivity patterns that make it indispensable for researchers exploring new drug discovery pathways. As a leading chemical synthesis company, ChemShuttle provides access to this compound through their extensive Library of Compounds, ensuring scientists worldwide can incorporate 2,6-dibromo-[1,2,4]triazolo[1,5-a]pyridine CAS 1401624-81-4 into their experiments. The company's commitment to high-quality chemical building blocks like this one demonstrates their role as a trusted worldwide chemical supplier. Researchers benefit from ChemShuttle's efficient distribution network, which delivers the CAS 1401624-81-4 compound promptly, supporting rapid advancement in pharmaceutical research. This screening compound's versatility in forming various organic chemicals makes it a cornerstone in modern medicinal chemistry laboratories.
Reviews
Write Your Own Review