1-m-tolyl-1H-1,2,4-triazole-3-carboxylic acid
$600.00
CAS No.: 1245649-64-2
Catalog No.: 188765
Purity: 95%
MF: C10H9N3O2
MW: 203.201
Storage: 2-8 degree Celsius
SMILES: C1(=CC(=CC=C1)N1N=C(N=C1)C(=O)O)C
Catalog No.: 188765
Purity: 95%
MF: C10H9N3O2
MW: 203.201
Storage: 2-8 degree Celsius
SMILES: C1(=CC(=CC=C1)N1N=C(N=C1)C(=O)O)C
1-m-tolyl-1H-1,2,4-triazole-3-carboxylic acid; CAS No.: 1245649-64-2; 1-m-tolyl-1H-1,2,4-triazole-3-carboxylic acid is a heterocycles compound offered by ChemShuttle, a chemical synthesis company. This cycles compounds is valuable in the synthesis of various organic chemicals. Our CRO chemical synthesis services allow for the efficient production of this compound, supporting research in diverse fields. It can be used as building blocks for drug discovery, providing researchers with essential components for the development of new pharmaceuticals and chemical products.
Reviews
Write Your Own Review