![7-(benzyloxy)-3,4,12,12a-tetrahydro-1H-[1,4]oxazino[3,4-c]pyrido[2,1-f][1,2,4]triazine-6,8-dione](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/z/b/zb0155_1.jpg)
![2-(3'-bromo-biphenyl-3-yl)-4,6-diphenyl-[1,3,5]triazine](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/z/b/zb0176_1.jpg)
2-([1,1'-biphenyl]-4-yl)-4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine
$200.00
CAS No.: 1642330-73-1
Catalog No.: ZB0161
Purity: 95%
MF: C33H30BN3O2
MW: 511.434
Storage: 2-8 degree Celsius
SMILES: C1(=CC=C(C=C1)C1=NC(=NC(=N1)C1=CC=CC=C1)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C)C1=CC=CC=C1
Catalog No.: ZB0161
Purity: 95%
MF: C33H30BN3O2
MW: 511.434
Storage: 2-8 degree Celsius
SMILES: C1(=CC=C(C=C1)C1=NC(=NC(=N1)C1=CC=CC=C1)C1=CC=C(C=C1)B1OC(C(O1)(C)C)(C)C)C1=CC=CC=C1
2-([1,1'-biphenyl]-4-yl)-4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine; CAS No.: 1642330-73-1; As a premier chemical synthesis company, ChemShuttle offers 2-([1,1'-biphenyl]-4-yl)-4-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3,5-triazine, which is classified as one of our key intermediates. This compound plays a crucial role in the development of various medicinal products. Our custom chemical synthesis services cater to the unique needs of researchers, providing access to specialized building blocks for drug discovery. With a global distribution network, we ensure timely delivery of high-quality compounds to support scientific advancement.
Reviews
Write Your Own Review