![2-(methylsulfanyl)-3H,4H-pyrrolo[2,1-f][1,2,4]triazin-4-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/7/171384_1.jpg)
trans-4-amino-1-Boc-3-methoxypiperidine
$400.00
CAS No.: 1232059-97-0
Catalog No.: 171386
Purity: 95%
MF: C11H22N2O3
MW: 230.308
Storage: 2-8 degree Celsius
SMILES: CO[C@H]1CN(CC[C@@H]1N)C(=O)OC(C)(C)C
Catalog No.: 171386
Purity: 95%
MF: C11H22N2O3
MW: 230.308
Storage: 2-8 degree Celsius
SMILES: CO[C@H]1CN(CC[C@@H]1N)C(=O)OC(C)(C)C
trans-4-amino-1-Boc-3-methoxypiperidine; CAS No.: 1232059-97-0; trans-4-amino-1-Boc-3-methoxypiperidine is a chemical building blocks offered by ChemShuttle, a custom chemical synthesis companies that specializes in providing various organic chemicals and key intermediates for drug discovery. This compound is an example of their heterocycles category, which are essential building blocks in modern pharmaceutical research. ChemShuttle s chemical synthesis company services include custom synthesis of such compounds, allowing for the development of novel pharmaceuticals. As a worldwide chemical supplier, ChemShuttle ensures the availability of this trans-4-amino-1-Boc-3-methoxypiperidine (CAS No.: 1232059-97-0) to researchers and industries seeking to explore its potential in various chemical processes. The company s commitment to quality and diversity in their chemical blocks makes them a reliable source for this and other similar compounds.
Reviews
Write Your Own Review