3-bromo-thieno[2,3-c]pyridine

3-bromo-thieno[2,3-c]pyridine

ethyl 3-amino-5-bromothieno[2,3-b]pyridine-2-carboxylate

ethyl 3-amino-5-bromothieno[2,3-b]pyridine-2-carboxylate

3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid

$300.00
CAS No.: 59488-60-7
Catalog No.: 194503
Purity: 95%
MF: C9H8N2O2S
MW: 208.242
Storage: 2-8 degree Celsius
SMILES: NC1=C(SC2=NC(=CC=C21)C)C(=O)O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194503
  • Size
    Price
    Stock
    Estimated Shipping Time
3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid; CAS No.: 59488-60-7; 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid. PROPERTIES: 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid is a crystalline solid. Its molecular formula is C8H7N3O2S, and the molecular weight is approximately 213.22 g/mol. The compound has a melting point of approximately 170-172 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a thienopyridine ring, an amino group, and a carboxylic acid group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid serves as a valuable intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The carboxylic acid group can participate in esterification and amidation reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:3-amino-6-methylthieno[2,3-b]pyridine-2-carboxylic acid
Your Rating