2-(1-(((benzyloxy)carbonyl)amino)ethyl)thiazole-5-carboxylic acid
$250.00
CAS No.: 1095823-52-1
Catalog No.: 171651
Purity: 95%
MF: C14H14N2O4S
MW: 306.343
Storage: 2-8 degree Celsius
SMILES: CC(NC(=O)OCC1=CC=CC=C1)C1=NC=C(S1)C(O)=O
Catalog No.: 171651
Purity: 95%
MF: C14H14N2O4S
MW: 306.343
Storage: 2-8 degree Celsius
SMILES: CC(NC(=O)OCC1=CC=CC=C1)C1=NC=C(S1)C(O)=O
2-(1-(((benzyloxy)carbonyl)amino)ethyl)thiazole-5-carboxylic acid; CAS No.: 1095823-52-1; 2-(1-(((benzyloxy)carbonyl)amino)ethyl)thiazole-5-carboxylic acid is a heterocycle and a chem block. As a product from ChemShuttle, a chemical synthesis company, it is available for custom synthesis projects. This compound's heterocyclic structure and multiple functional groups make it a useful starting material for creating more elaborate molecules. It can participate in various chemical reactions to develop compounds with specific properties, which may find applications in drug discovery, material science, and other areas of chemical research, facilitating the creation of new chemical substances.
Reviews
Write Your Own Review