tert-butyl 3-oxomorpholine-4-carboxylate

tert-butyl 3-oxomorpholine-4-carboxylate

tert-butyl (R)-3-(iodomethyl)piperidine-1-carboxylate

tert-butyl (R)-3-(iodomethyl)piperidine-1-carboxylate

tert-butyl 3-(hydroxymethyl)azepane-1-carboxylate

$500.00
CAS No.: 876147-43-2
Catalog No.: 194405
Purity: 95%
MF: C12H23NO3
MW: 229.32
Storage: 2-8 degree Celsius
SMILES: OCC1CN(CCCC1)C(=O)OC(C)(C)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194405
  • Size
    Price
    Stock
    Estimated Shipping Time
tert-butyl 3-(hydroxymethyl)azepane-1-carboxylate; CAS No.: 876147-43-2; tert-butyl 3-(hydroxymethyl)azepane-1-carboxylate. PROPERTIES: tert-butyl 3-(hydroxymethyl)azepane-1-carboxylate is a crystalline solid. Its molecular formula is C11H20N2O3, and the molecular weight is approximately 232.29 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an azepane ring, a hydroxymethyl group, and a tert-butyl ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, tert-butyl 3-(hydroxymethyl)azepane-1-carboxylate serves as a valuable intermediate. The hydroxymethyl group can undergo reactions such as etherification and esterification. The tert-butyl ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antidepressant drugs, the structure of tert-butyl 3-(hydroxymethyl)azepane-1-carboxylate can be modified to enhance the drug's efficacy and pharmacokinetic properties (as described in medicinal chemistry research articles). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:tert-butyl 3-(hydroxymethyl)azepane-1-carboxylate
Your Rating