(R)-1-((4-fluoro-3-(trifluoromethyl)phenyl)sulfonyl)pyrrolidin-3-ol
$780.00
CAS No.: 2134830-47-8
Catalog No.: 185164
Purity: 95%
MF: C11H11F4NO3S
MW: 313.272
Storage: 2-8 degree Celsius
SMILES: O[C@@H]1CCN(C1)S(=O)(=O)C1=CC(=C(F)C=C1)C(F)(F)F
Catalog No.: 185164
Purity: 95%
MF: C11H11F4NO3S
MW: 313.272
Storage: 2-8 degree Celsius
SMILES: O[C@@H]1CCN(C1)S(=O)(=O)C1=CC(=C(F)C=C1)C(F)(F)F
(R)-1-((4-fluoro-3-(trifluoromethyl)phenyl)sulfonyl)pyrrolidin-3-ol; CAS No.: 2134830-47-8; As a worldwide chemical supplier; ChemShuttle supplies key intermediates like (R)-1-((4-fluoro-3-(trifluoromethyl)phenyl)sulfonyl)pyrrolidin-3-ol, a structurally complex pyrrolidine derivative. This compound is valuable for asymmetric synthesis and drug design due to its stereospecific hydroxyl group. The company s Small molecules synthesis capabilities ensure precise control over chiral centers and functional group compatibility, catering to diverse research needs. ChemShuttle s portfolio emphasizes fluorinated building blocks, essential for optimizing drug candidates pharmacokinetic properties.
Reviews
Write Your Own Review