![N-[2-methoxy-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-yl]benzenesulfonamide](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/5/153325_6.jpg)
N-tert-butyl-3-(2-chloro-5-methylpyrimidin-4-ylamino)benzenesulfonamide
$200.00
CAS No.: 936092-53-4
Catalog No.: 149129
Purity: 95%
MF: C15H19ClN4O2S
MW: 354.863
Storage: 2-8 degree Celsius
SMILES: CC1=C(NC2=CC=CC(=C2)S(=O)(=O)NC(C)(C)C)N=C(Cl)N=C1
Catalog No.: 149129
Purity: 95%
MF: C15H19ClN4O2S
MW: 354.863
Storage: 2-8 degree Celsius
SMILES: CC1=C(NC2=CC=CC(=C2)S(=O)(=O)NC(C)(C)C)N=C(Cl)N=C1
N-tert-butyl-3-(2-chloro-5-methylpyrimidin-4-ylamino)benzenesulfonamide; CAS No.: 936092-53-4 - This bioactive compound is essential in the development of new drugs, offering potential benefits in treating various conditions. ChemShuttle's extensive catalog and efficient distribution network enhance its utility in pharmaceutical research.
Reviews
Write Your Own Review